| Company Name: |
Shanghai Devinchem Ltd
|
| Tel: |
027-65318838 13646286950 |
| Email: |
sales@devinchem.com |
| Products Intro: |
Product Name:5-(Trifluoromethyl)-7-azaindole-3-carboxylic acid methyl ester
CAS:1190320-31-0
Purity:97% Package:1G,5G,10G,100G,1KG Remarks:CL1985
|
| Company Name: |
Nanjing KaiMubo Pharmaceutical Co., Ltd.
|
| Tel: |
025-66162170 |
| Email: |
|
| Products Intro: |
Product Name:5-(Trifluoromethyl)-7-azaindole-3-carboxylic acid methyl ester
CAS:1190320-31-0
Purity:95% HPLC Package:5G;10G;25G
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Methyl 5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxylate
|
|
| | 5-(TrifluoroMethyl)-7-azaindole-3-carboxylic acid Methyl ester Basic information |
| | 5-(TrifluoroMethyl)-7-azaindole-3-carboxylic acid Methyl ester Chemical Properties |
| form | solid | | InChI | 1S/C10H7F3N2O2/c1-17-9(16)7-4-15-8-6(7)2-5(3-14-8)10(11,12)13/h2-4H,1H3,(H,14,15) | | InChIKey | RVFKEFXJTGCINI-UHFFFAOYSA-N | | SMILES | COC(=O)c1c[nH]c2ncc(cc12)C(F)(F)F |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 5-(TrifluoroMethyl)-7-azaindole-3-carboxylic acid Methyl ester Usage And Synthesis |
| | 5-(TrifluoroMethyl)-7-azaindole-3-carboxylic acid Methyl ester Preparation Products And Raw materials |
|