|
|
| | 1-propyl-2-MethyliMidazole Basic information |
| | 1-propyl-2-MethyliMidazole Chemical Properties |
| InChI | InChI=1S/C7H12N2/c1-3-5-9-6-4-8-7(9)2/h4,6H,3,5H2,1-2H3 | | InChIKey | SIQHSJOKAUDDLN-UHFFFAOYSA-N | | SMILES | C1(C)N(CCC)C=CN=1 |
| | 1-propyl-2-MethyliMidazole Usage And Synthesis |
| Uses | 1-propyl-2-MethyliMidazole is a kind of imidazole, which is an important five-membered nitrogen-containing heterocyclic compound. Among the numerous heterocyclic compounds, imidazole and its derivatives are regarded as a unique and multifaceted scaffold material due to their diverse applications in industrial, organic and pharmaceutical chemistry. |
| | 1-propyl-2-MethyliMidazole Preparation Products And Raw materials |
|