|
|
| | Methanone, (4-broMophenyl)(3-chloro-1H-indol-7-yl)- Basic information |
| Product Name: | Methanone, (4-broMophenyl)(3-chloro-1H-indol-7-yl)- | | Synonyms: | Methanone, (4-broMophenyl)(3-chloro-1H-indol-7-yl)-;3-chloro-7-(4-bromobenzoyl)-indole;7-(4-bromobenzoyl)-3-chloro-1H-indole;Bromfenac sodium Impurity 15;Bromfenac Impurity 42;(4-?bromophenyl)?(3-?chloro-?1H-R...;(4-bromophenyl)(3-chloro-1H-indol-7-yl)methanone;BromfecImpurity42 | | CAS: | 91714-51-1 | | MF: | C15H9BrClNO | | MW: | 334.6 | | EINECS: | | | Product Categories: | | | Mol File: | 91714-51-1.mol |  |
| | Methanone, (4-broMophenyl)(3-chloro-1H-indol-7-yl)- Chemical Properties |
| Melting point | 193-194 °C(Solv: ethyl acetate (141-78-6)) | | Boiling point | 496.3±30.0 °C(Predicted) | | density | 1.607±0.06 g/cm3(Predicted) | | pka | 13.47±0.30(Predicted) | | InChI | InChI=1S/C15H9BrClNO/c16-10-6-4-9(5-7-10)15(19)12-3-1-2-11-13(17)8-18-14(11)12/h1-8,18H | | InChIKey | AQGAUDHKENVWGE-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(Br)C=C1)(C1C2=C(C=CC=1)C(Cl)=CN2)=O |
| | Methanone, (4-broMophenyl)(3-chloro-1H-indol-7-yl)- Usage And Synthesis |
| | Methanone, (4-broMophenyl)(3-chloro-1H-indol-7-yl)- Preparation Products And Raw materials |
|