| Company Name: |
Cochemical Ltd.
|
| Tel: |
029-86115547 17791676824 |
| Email: |
sales@cochemical.com |
| Products Intro: |
Product Name:Methyl 5-chloro-2-(trifluoroMethylsulfonaMido)benzoate CAS:84466-05-7 Purity:96% HMNR Package:1G;5G;25G;100G;1KG
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
CAS:84466-05-7
|
| Company Name: |
Cochemical Ltd.
|
| Tel: |
029-86115547 17791676824 |
| Email: |
sales@cochemical.com |
| Products Intro: |
Product Name:Methyl 5-chloro-2-(trifluoroMethylsulfonaMido)benzoate CAS:84466-05-7 Purity:96% HMNR Package:1G;5G;25G;100G;1KG
|
|
| | Methyl 5-chloro-2-(trifluoroMethylsulfonaMido)benzoate Basic information |
| Product Name: | Methyl 5-chloro-2-(trifluoroMethylsulfonaMido)benzoate | | Synonyms: | Methyl 5-chloro-2-(trifluoroMethylsulfonaMido)benzoate;5-Chloro-2-{[(trifluoromethyl)sulfonyl]amino}benzoic acid methyl ester;Amidoflumet;Methyl 5-chloro-2-{[(trifluoromethyl)sulfonyl]amino}benzoate;Benzoic acid, 5-chloro-2-[[(trifluoromethyl)sulfonyl]amino]-, methyl ester | | CAS: | 84466-05-7 | | MF: | C9H7ClF3NO4S | | MW: | 317.67 | | EINECS: | | | Product Categories: | | | Mol File: | 84466-05-7.mol |  |
| | Methyl 5-chloro-2-(trifluoroMethylsulfonaMido)benzoate Chemical Properties |
| Melting point | 80.7 °C | | Boiling point | 348.3±52.0 °C(Predicted) | | density | 1.619±0.06 g/cm3(Predicted) | | pka | 2.92±0.10(Predicted) | | Major Application | agriculture environmental | | InChI | 1S/C9H7ClF3NO4S/c1-18-8(15)6-4-5(10)2-3-7(6)14-19(16,17)9(11,12)13/h2-4,14H,1H3 | | InChIKey | KBHDSWIXRODKSZ-UHFFFAOYSA-N | | SMILES | CS(=O)(=O)Nc1ccc(Cl)cc1C(=O)OC(F)(F)F |
| Hazard Codes | T,N | | Risk Statements | 25-51/53 | | Safety Statements | 45-61 | | RIDADR | UN2811 - class 6.1 - PG 3 - EHS - Toxic solids, organic, n.o.s., HI: all | | WGK Germany | 3 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 2 |
| | Methyl 5-chloro-2-(trifluoroMethylsulfonaMido)benzoate Usage And Synthesis |
| Uses | Amidoflumet is an Acaricide. | | General Description | Miticide for house dust mites |
| | Methyl 5-chloro-2-(trifluoroMethylsulfonaMido)benzoate Preparation Products And Raw materials |
|