| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:Sulfamethazine 13C6 (phenyl 13C6)
CAS:77643-91-5
Purity:CP：95%，atom：98% Package:10mg Remarks:B28752
|
| Company Name: |
ShangHai Anpel Co, Ltd.
|
| Tel: |
18501792038 18502138905 |
| Email: |
shanpel@anpel.com.cn |
| Products Intro: |
Product Name:Sulfamethazine-[13C6
CAS:77643-91-5
Purity:100ppm Package:100mg/L于甲醇，1.2ml Remarks:CDAA-540020C6-10mg
|
| Company Name: |
Reer Technology (Shanghai) Co., LTD
|
| Tel: |
021-64400900 15800436310 |
| Email: |
bessey@reertech.com |
| Products Intro: |
Product Name:SULFAMETHAZINE(PHENYL-13C6, 99%)
CAS:77643-91-5
Purity:98% Package:0.01 G；1.2ML Remarks:CLM-3045-0.01
|
|
| | SULFAMETHAZINE (Phenyl-13C6, 99%) Basic information |
| Product Name: | SULFAMETHAZINE (Phenyl-13C6, 99%) | | Synonyms: | SULFAMETHAZINE (Phenyl-13C6, 99%);13C6-Sulfamethazine;SULFAMETHAZINE (PHENYL-13C6, 90%) 100 UG/ML IN ACETONITRILE;13C6]-Sulfadimidine;Sulfamethazine-13C6 (phenyl-13C6) in methanol;Benzene-13C6-sulfonamide, 4-amino-N-(4,6-dimethyl-2-pyrimidinyl)-;Sulfamethazine 13C6 (phenyl 13C6);Sulfamethazine (phenyl-13C?, 99%) | | CAS: | 77643-91-5 | | MF: | C12H14N4O2S | | MW: | 284.29 | | EINECS: | | | Product Categories: | | | Mol File: | 77643-91-5.mol |  |
| | SULFAMETHAZINE (Phenyl-13C6, 99%) Chemical Properties |
| density | 1.393±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C12H14N4O2S/c1-8-7-9(2)15-12(14-8)16-19(17,18)11-5-3-10(13)4-6-11/h3-7H,13H2,1-2H3,(H,14,15,16)/i3+1,4+1,5+1,6+1,10+1,11+1 | | InChIKey | ASWVTGNCAZCNNR-BULCFLCISA-N | | SMILES | S([13C]1[13CH]=[13CH][13C](=[13CH][13CH]=1)N)(=O)(=O)NC1=NC(=CC(=N1)C)C | | EPA Substance Registry System | Benzene-13C6-sulfonamide, 4-amino-N-(4,6-dimethyl-2-pyrimidinyl)- (77643-91-5) |
| | SULFAMETHAZINE (Phenyl-13C6, 99%) Usage And Synthesis |
| Uses | Sulfamethazine-13C6 is a 13C-labeled n-Acetyl-s-methyl-l-cysteine[1]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-223. DOI:10.1080/02688697.2018.1500521 |
| | SULFAMETHAZINE (Phenyl-13C6, 99%) Preparation Products And Raw materials |
|