| Company Name: |
ShangHai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847 13636370518 |
| Email: |
shyysw007@163.com |
| Products Intro: |
Product Name:Quercetin 3-O-(6″-O-malonyl)-β-D-glucoside
CAS:96862-01-0
Purity:HPLC>=98% Package:5mg Remarks:B27834
|
| Company Name: |
Chengdu Biopurify Phytochemicals Ltd.
|
| Tel: |
+86-028-82633397 18982077548 |
| Email: |
cwb1@biopurify.cn |
| Products Intro: |
Product Name:Quercetin 3-O-(6''-O-malonyl)-β-D-glucoside
CAS:96862-01-0
Purity:>95%,98%,99% Package:From mgs to grams,up to Kgs.Inquire for Bulk scale.
|
Quercetin 3-O-malonylglucoside manufacturers
|
| | Quercetin 3-O-malonylglucoside Basic information |
| Product Name: | Quercetin 3-O-malonylglucoside | | Synonyms: | Quercetin 3-O-(6?″-O-malonyl)-β-D-glucoside;Quercetin 3-O-malonylglucoside;quercetin 3-O-(6-O-malonyl-beta-D-glucoside);quercetin 3-O-β-D-(6''-O-malonyl)-glucopyranoside;Quercetin-3-O-(6-O-malonyl-b-Dglucopyranoside;Quercetin 3-?O-?(6''-?O-?Malonyl)?-?β-?D-?glucoside;4H-1-Benzopyran-4-one, 3-[[6-O-(2-carboxyacetyl)-β-D-glucopyranosyl]oxy]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-;Quercetin 3-O-(6''-O-malonyl)-β-D-glucoside | | CAS: | 96862-01-0 | | MF: | C24H22O15 | | MW: | 550.42 | | EINECS: | | | Product Categories: | | | Mol File: | 96862-01-0.mol |  |
| | Quercetin 3-O-malonylglucoside Chemical Properties |
| Melting point | 195-201 °C | | Boiling point | 957.2±65.0 °C(Predicted) | | density | 1.86±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO (Slightly), Water (Slightly, Heated) | | form | Solid | | pka | 2.70±0.32(Predicted) | | color | Pale Yellow to Light Yellow | | BRN | 6625918 | | Stability: | Hygroscopic | | InChIKey | NBQPHANHNTWDML-UJKBSQBPSA-N | | SMILES | O[C@H]1[C@H](O)[C@@H](COC(=O)CC(O)=O)O[C@@H](OC2=C(Oc3cc(O)cc(O)c3C2=O)c4ccc(O)c(O)c4)[C@@H]1O |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | Quercetin 3-O-malonylglucoside Usage And Synthesis |
| Uses | Quercetin 3-O-(6''''-O-Malonyl)-β-D-glucoside is a Quercetin (Q509500), a flavonoid with anticancer activity. It is a mitochondrial ATPase and phosphodiesterase inhibitor. It Inhibits PI3-kinase activity and slightly inhibits PIP kinase activity. | | Definition | ChEBI: A quercetin O-glucoside that is quercetin attached to a 6-O-malonyl-beta-D-glucopyranosyl residue at position 3 via a glycosidic linkage. | | Biological Activity | Metabolite in flavone and flavonol biosynthesis, is found in plants like the fruit peel of Sicana odorifera and mulberry leaves, shows antioxidant activity. Q3MG also potentially has antiatherogenic protective effects; and found to improve hyperglycemia in obese mice and reduced oxidative stress in the liver. |
| | Quercetin 3-O-malonylglucoside Preparation Products And Raw materials |
|