|
|
| | 2,4-Dichlorobenzonitrile Basic information |
| Product Name: | 2,4-Dichlorobenzonitrile | | Synonyms: | 2,4-DICHLOROBENZONITRILE;AKOS B004070;Benzonitrile, 2,4-dichloro-;2,4-Dichlor-Benzonitril;2,4-Dichlorobenzonitrile 97%;2.4-DICHLORBENZONITRILE +99%;2,4-Dichlorobenzonitrile,98%;2,4-Dichlorobenzonit | | CAS: | 6574-98-7 | | MF: | C7H3Cl2N | | MW: | 172.01 | | EINECS: | 229-493-2 | | Product Categories: | FINE Chemical & INTERMEDIATES;Boron, Nitrile, Thio,& TM-Cpds;Chlorobenzene Series;Halides;Aromatic Nitriles;Nitriles | | Mol File: | 6574-98-7.mol |  |
| | 2,4-Dichlorobenzonitrile Chemical Properties |
| Melting point | 57-61 °C | | Boiling point | 125 °C / 15mmHg | | density | 1.4980 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Store below +30°C. | | solubility | soluble in Methanol | | form | Solid:bulk | | color | White to Almost white | | Water Solubility | insoluble | | BRN | 637738 | | InChI | InChI=1S/C7H3Cl2N/c8-6-2-1-5(4-10)7(9)3-6/h1-3H | | InChIKey | GRUHREVRSOOQJG-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=C(Cl)C=C1Cl | | CAS DataBase Reference | 6574-98-7(CAS DataBase Reference) | | NIST Chemistry Reference | 2,4-Dichlorobenzonitrile(6574-98-7) |
| Hazard Codes | Xn,T,Xi | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 36/37/39-26-36-36/37-9 | | RIDADR | 3276 | | WGK Germany | WGK 2 water endangering | | Hazard Note | Irritant/Toxic | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269095 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| | 2,4-Dichlorobenzonitrile Usage And Synthesis |
| Chemical Properties | white to almost white crystalline powder | | Uses | Used as intermediate for the synthesis of agrochemicals, pharmaceuticals and chemical intermediates. | | Synthesis Reference(s) | Synthetic Communications, 25, p. 2993, 1995 DOI: 10.1080/00397919508011431 |
| | 2,4-Dichlorobenzonitrile Preparation Products And Raw materials |
|