5-butylbenzene-1,3-diol manufacturers
|
| | 5-butylbenzene-1,3-diol Basic information |
| | 5-butylbenzene-1,3-diol Chemical Properties |
| Melting point | 81.5-82.5 °C | | Boiling point | 151-152 °C | | density | 1.092±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 9.56±0.10(Predicted) | | form | Solid | | color | Off-White to Light Beige | | InChI | InChI=1S/C10H14O2/c1-2-3-4-8-5-9(11)7-10(12)6-8/h5-7,11-12H,2-4H2,1H3 | | InChIKey | JOZMGUQZTOWLAS-UHFFFAOYSA-N | | SMILES | C1(O)=CC(CCCC)=CC(O)=C1 |
| | 5-butylbenzene-1,3-diol Usage And Synthesis |
| Uses | 5-Butylresorcinol and other alkyl resorcinol have been studied for their bactericidal properties. It has been also used in the study of hydrophobicity of 1-methyl-3,5-dioxybenzene, 1-butyl-3,5-dioxybenzene, and 1-hexyl-3,5-dioxybenzene studied by DFT-ROB3LYP and PM3 methods calcg. their complexes with H2O mol. and octanol |
| | 5-butylbenzene-1,3-diol Preparation Products And Raw materials |
|