| Company Name: |
XIAMEN SINOPEG BIOTECH CO., LTD. |
| Tel: |
+86-0592-7761068 +8617350879715 |
| Email: |
changaiwei@sinopeg.com |
| Products Intro: |
Product Name:2,5-dioxopyrrolidin-1-yl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oate Purity:98% Package:1g;|10g;|100g;
|
|
|
|
|
- 2,5-dioxopyrrolidin-1-yl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oate
-
-
2026-07-24
- CAS:2055033-05-9
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 1g/bottle, 10g/bottle, 100g/bottle
- Mal-PEG8-NHS ester
-
-
2025-06-07
- CAS:2055033-05-9
- Min. Order: 250mg
- Purity: >98.00%
- Supply Ability: 250mg
|
| | Mal-PEG8-NHS ester Basic information | | Purity |
| Product Name: | Mal-PEG8-NHS ester | | Synonyms: | Mal-PEG8-NHS ester;2,5-Dioxo-1-pyrrolidinyl 1-(2,5-Dioxo-2,5-dihydro-1-pyrrolyl)-3,6,9,12,15,18,21,24-octaoxa-27-heptacosanoate;4,7,10,13,16,19,22,25-Octaoxaheptacosanoic acid, 27-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-, 2,5-dioxo-1-pyrrolidinyl ester;(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate;Mal-PEG8-CH2CH2COONHS;2,5-Dioxopyrrolidin-1-yl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oate | | CAS: | 2055033-05-9 | | MF: | C27H42N2O14 | | MW: | 618.63 | | EINECS: | | | Product Categories: | | | Mol File: | 2055033-05-9.mol |  |
| | Mal-PEG8-NHS ester Chemical Properties |
| Boiling point | 689.3±65.0 °C(Predicted) | | density | 1.29±0.1 g/cm3(Predicted) | | storage temp. | -20℃ | | solubility | Soluble in DMSO, DCM, DMF | | pka | -2.34±0.20(Predicted) | | form | Viscous Liquid | | color | Colorless to light yellow | | InChI | InChI=1S/C27H42N2O14/c30-23-1-2-24(31)28(23)6-8-36-10-12-38-14-16-40-18-20-42-22-21-41-19-17-39-15-13-37-11-9-35-7-5-27(34)43-29-25(32)3-4-26(29)33/h1-2H,3-22H2 | | InChIKey | JJKBMZPIICCZSX-UHFFFAOYSA-N | | SMILES | C(ON1C(=O)CCC1=O)(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN1C(=O)C=CC1=O |
| | Mal-PEG8-NHS ester Usage And Synthesis |
| Purity | ≥99% | | Description | Mal-PEG8-NHS ester is a PEG linker containing a maleimide group and an NHS ester group. The hydrophilic PEG spacer increases solubility in aqueous media. | | Uses | Mal-PEG8-NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. | | General Description | Mal-PEG8-NHS ester (CAS 2055033-05-9) is a high-purity, PEG-based PROTAC linker suitable for the synthesis of PROTACs. It has a molecular weight of 618.63 and appears as a colourless to pale yellow viscous liquid or a low-melting-point waxy solid at room temperature. | | IC 50 | PEGs |
| | Mal-PEG8-NHS ester Preparation Products And Raw materials |
|