| Company Name: |
Zhengzhou Convergence Chemical Co. LTD Gold
|
| Tel: |
13393710386 |
| Email: |
3941078109@qq.com |
| Products Intro: |
Product Name:Benzenamine, 4-methoxy-N,N-bis(4-methoxyphenyl)-
CAS:13050-56-1
Purity:97% Package:1瓶
|
| Company Name: |
Henan Lien Chemical Products Co., Ltd.
|
| Tel: |
0371-63357898 15378766539 |
| Email: |
535046669@qq.com |
| Products Intro: |
Product Name:Tris(4-methoxyphenyl)amine
CAS:13050-56-1
Purity:98% Package:25g 50g 100g 250g 500g
|
| Company Name: |
Zhengzhou Edward Biology Co.,Ltd
|
| Tel: |
0371-63682289 15538176268 |
| Email: |
jacschem@163.com |
| Products Intro: |
Product Name:13050-56-1
CAS:13050-56-1
Purity:98% Package:1g 5g 10g 25g 50g 100g 500g 1kg
|
|
| | Benzenamine, 4-methoxy-N,N-bis(4-methoxyphenyl)- Basic information |
| | Benzenamine, 4-methoxy-N,N-bis(4-methoxyphenyl)- Chemical Properties |
| storage temp. | 2-8°C, protect from light | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C21H21NO3/c1-23-19-10-4-16(5-11-19)22(17-6-12-20(24-2)13-7-17)18-8-14-21(25-3)15-9-18/h4-15H,1-3H3 | | InChIKey | AMLOAIZZHUTCIJ-UHFFFAOYSA-N | | SMILES | C1(N(C2=CC=C(OC)C=C2)C2=CC=C(OC)C=C2)=CC=C(OC)C=C1 |
| | Benzenamine, 4-methoxy-N,N-bis(4-methoxyphenyl)- Usage And Synthesis |
| Uses | Tris(4-methoxyphenyl)amine acts as a mediator in dye-sensitized solar cells. |
| | Benzenamine, 4-methoxy-N,N-bis(4-methoxyphenyl)- Preparation Products And Raw materials |
|