| Company Name: |
3B Pharmachem (Wuhan) International Co.,Ltd.
|
| Tel: |
18930552037 |
| Email: |
3bsc@sina.com |
| Products Intro: |
Product Name:8-HYDROXY-DPAT HYDROBROMIDE CAS:87394-87-4 Purity:99% HPLC Package:1Mg ; 5Mg;10Mg ;100Mg;250Mg ;500Mg ;1g;2.5g ;5g ;10g
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(±)-8-Hydroxy-2-(dipropylaMino)tetralin hydrobroMide CAS:87394-87-4 Purity:>=98% Package:100MG,25MG
|
8-HYDROXY-DPAT HYDROBROMIDE manufacturers
|
| | 8-HYDROXY-DPAT HYDROBROMIDE Basic information |
| | 8-HYDROXY-DPAT HYDROBROMIDE Chemical Properties |
| form | White solid. | | InChI | 1S/C16H25NO.BrH/c1-3-10-17(11-4-2)14-9-8-13-6-5-7-16(18)15(13)12-14;/h5-7,14,18H,3-4,8-12H2,1-2H3;1H | | InChIKey | BATPBOZTBNNDLN-UHFFFAOYSA-N | | SMILES | Br[H].CCCN(CCC)C1CCc2cccc(O)c2C1 | | EPA Substance Registry System | 1-Naphthalenol, 7-(dipropylamino)-5,6,7,8-tetrahydro-, hydrobromide (1:1) (87394-87-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 8-HYDROXY-DPAT HYDROBROMIDE Usage And Synthesis |
| Uses | (±)-8-Hydroxy-2-(dipropylamino)tetralin hydrobromide is a potent and selective 5-hydroxytryptamine (5HT1A)-receptor agonist which is generally used as the standard in pharmacological studies. | | Biochem/physiol Actions | Selective 5-HT1 agonist with high affinity for subtype 5-HT1A receptor. |
| | 8-HYDROXY-DPAT HYDROBROMIDE Preparation Products And Raw materials |
|