|
|
| | Pyridine-triphenylborane Basic information | | Uses |
| Product Name: | Pyridine-triphenylborane | | Synonyms: | PYRIDINE-TRIPHENYLBORANE COMPLEX;Pyridine-triphenylborane;Pyridine-triPhenylborate;Pyridine-triphenylborane(1/1);Pyridine-triphenylbo;Triphenyl(pyridin-1-iuM-1-yl)borate;Boron,triphenyl(pyridine)-, (T-4)-;Triphenyl borane,pyridine complex | | CAS: | 971-66-4 | | MF: | C23H20BN | | MW: | 321.22 | | EINECS: | | | Product Categories: | | | Mol File: | 971-66-4.mol |  |
| | Pyridine-triphenylborane Chemical Properties |
| Melting point | 214-215 °C (decomp) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C23H20BN/c1-5-13-21(14-6-1)24(22-15-7-2-8-16-22,23-17-9-3-10-18-23)25-19-11-4-12-20-25/h1-20H | | InChIKey | SFZYDSQSIXWONY-UHFFFAOYSA-N | | SMILES | [N+]1(=CC=CC=C1)[B-](C1=CC=CC=C1)(C1C=CC=CC=1)C1=CC=CC=C1 | | EPA Substance Registry System | Boron, triphenyl(pyridine)-, (T-4)- (971-66-4) |
| | Pyridine-triphenylborane Usage And Synthesis |
| Uses | Pyridine triphenylborone is a heterocyclic organic compound that can be used as a pharmaceutical intermediate. | | Chemical Properties | White micro-crystalline powder |
| | Pyridine-triphenylborane Preparation Products And Raw materials |
|