| Company Name: |
ChemeGen Gold
|
| Tel: |
18818260767 |
| Email: |
2625930290@qq.com |
| Products Intro: |
Product Name:Propafenone-d5 hydrochloride
CAS:1346605-05-7
Purity:98% Package:10 mg;50 mg;100 mg;500 mg;1 g;5 g;10 g
|
| Company Name: |
Daicel Chiral Technologies (China)CO.,LTD
|
| Tel: |
021-50460086-9 15921403865 |
| Email: |
han_yajun@dctc.daicel.com |
| Products Intro: |
Product Name:Propafenone-?d5 Hydrochloride
CAS:1346605-05-7
Purity:95%HPLC Package:10MG;25MG;50MG;100MG Remarks:DCTI-A-233
|
| Company Name: |
Shenzhen SUNGENING Bio-Medical Co., Ltd.
|
| Tel: |
0755-28967200 13631290199 |
| Email: |
wxf@sungening.com |
| Products Intro: |
Product Name:Propafenone D5 HCl
CAS:1346605-05-7
Purity:99% HPLC or More Package:10MG;25MG;50MG;100MG
|
PROPAFENONE-D5 HCL manufacturers
|
| | PROPAFENONE-D5 HCL Basic information |
| Product Name: | PROPAFENONE-D5 HCL | | Synonyms: | PROPAFENONE-D5 HCL;1-[2-[1,1,2,3,3-pentadeuterio-2-hydroxy-3-(propylamino)propoxy]phenyl]-3-phenylpropan-1-one:hydrochloride;[2H5]-Propafenone Hydrochloride;Propafenone Impurity 26;Propafenone-d5 (propoxy-d5) hydrochloride;Propafenone-d5 HCl (Propoxy-d5) | | CAS: | 1346605-05-7 | | MF: | C21H23ClD5NO3 | | MW: | 382.94 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | PROPAFENONE-D5 HCL Chemical Properties |
| storage temp. | -20°C | | solubility | DMSO: soluble,Methanol: soluble | | form | A solid | | InChI | InChI=1S/C21H27NO3.ClH/c1-2-14-22-15-18(23)16-25-21-11-7-6-10-19(21)20(24)13-12-17-8-4-3-5-9-17;/h3-11,18,22-23H,2,12-16H2,1H3;1H/i15D2,16D2,18D; | | InChIKey | XWIHRGFIPXWGEF-FIFLIBHCSA-N | | SMILES | C(C1=CC=CC=C1OC([2H])([2H])C([2H])(O)C([2H])([2H])NCCC)(=O)CCC1=CC=CC=C1.[H]Cl |
| | PROPAFENONE-D5 HCL Usage And Synthesis |
| Uses | Sodium channel blocker. Antiarrhythmic (class IC). |
| | PROPAFENONE-D5 HCL Preparation Products And Raw materials |
|