|
|
| | BZ-GLY-LYS-OH Basic information |
| Product Name: | BZ-GLY-LYS-OH | | Synonyms: | HIPPURYL-LYS;HIPPURYL-LYSINE;HIPPURYL-LYS-OH;HIPP-L-LYS;H-HIP-LYS-OH;BZ-GLY-LYS;BZ-GLY-LYS-OH;BENZOYL-GLY-L-LEU | | CAS: | 740-63-6 | | MF: | C15H21N3O4 | | MW: | 307.35 | | EINECS: | | | Product Categories: | | | Mol File: | 740-63-6.mol |  |
| | BZ-GLY-LYS-OH Chemical Properties |
| Melting point | 223-226 °C | | Boiling point | 662.255±55.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.230±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | −20°C | | solubility | water: 50 mg/mL, clear, colorless | | form | powder | | pka | 3.314±0.10(predicted) | | Water Solubility | water: 50mg/mL, clear, colorless | | InChI | 1S/C15H21N3O4/c16-9-5-4-8-12(15(21)22)18-13(19)10-17-14(20)11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,16H2,(H,17,20)(H,18,19)(H,21,22) | | InChIKey | LRCZLURYHGISRZ-UHFFFAOYSA-N | | SMILES | NCCCCC(NC(=O)CNC(=O)c1ccccc1)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | BZ-GLY-LYS-OH Usage And Synthesis |
| Uses | BZ-GLY-LYS-OH is a useful research chemical. |
| | BZ-GLY-LYS-OH Preparation Products And Raw materials |
|