- TBTU
-
- $700.00
-
2026-06-02
- CAS:125700-67-6
- Min. Order: 1KG
- Purity: 99
- Supply Ability: 50TONS
|
| Product Name: | TBTU | | Synonyms: | O-(1H-BENZOTRIAZOL-1-YL)-N,N,N',N'-TETRAMETHYLURONIUM TETRAFLUOROBORATE;O-(1H-BENZOTRIAZOLE-1-YL) N,N,N',N'-TETRAMETHYL URONIUM TETRAFLUOROBORATE;O-(1H-BENZOTRIAZOL-1-YL)-1,1,3,3-TETRAMETHYL-URONIUM TETRAFLUOROBORATE;O-(1H-BENZOTRIAZOL-1-YL)-N,N,N',N'-PENTAMETHYLENE-URONIUM TETRAFLUOROBORATE;O-(1H-BENZO-1,2,3-TRIAZOL-1-YL)-N,N,N',N'-TETRAMETHYL-URONIUM TETRAFLUOROBORATE;O-(BENZOTRIAZOL-1-YL)-1,1,3,3-TETRAMETHYLURONIUM TETRAFLUOROBORATE;N-[(1H-BENZOTRIAZOL-1-YL)(DIMETHYL-AMINO)METHYLENE]-N-METHYL-METHANAMINIUM TETRAFLUOROBORATE;TBPIPU | | CAS: | 125700-67-6 | | MF: | C11H16BF4N5O | | MW: | 321.09 | | EINECS: | 603-087-9 | | Product Categories: | Peptide Coupling Reagents;B (Classes of Boron Compounds);Biochemistry;Condensation & Active Esterification;Coupling Reactions (Peptide Synthesis);Peptide Synthesis;Amino Acid Derivatives;Coupling Reagent;PROTECTED AMINO ACID & PEPTIDES;Synthetic Organic Chemistry;Tetrafluoroborates;Peptide;125700-67-6 | | Mol File: | 125700-67-6.mol |  |
| Melting point | 205 °C (dec.)(lit.) | | storage temp. | 2-8°C | | solubility | acetonitrile: 0.1 g/mL, clear | | form | Powder | | color | White to Almost white | | Water Solubility | Soluble in acetonitrile (100 mg/ml, clear, colorless), DMF (160.55 mg/ml, clear), and water (3 mg/ml at 20°C). | | Sensitive | Moisture Sensitive | | BRN | 7066325 | | Major Application | peptide synthesis | | InChI | InChI=1S/C11H16N5O.BF4/c1-13(2)11(14(3)4)15-9-7-5-6-8-10(9)16(17)12-15;2-1(3,4)5/h5-8H,1-4H3;/q+1;-1 | | InChIKey | NQGZJNPFMLJDKU-UHFFFAOYSA-M | | SMILES | [B+3]([F-])([F-])([F-])[F-].C(=[N+]1/N=N(=O)C2=CC=CC=C/12)(\N(C)C)/N(C)C | | LogP | -2.65 at 21℃ | | CAS DataBase Reference | 125700-67-6(CAS DataBase Reference) | | EPA Substance Registry System | 1H-Benzotriazolium, 1-[bis(dimethylamino)methylene]-, 3-oxide, tetrafluoroborate(1-) (1:1) (125700-67-6) |
| Hazard Codes | Xi,F,E | | Risk Statements | 36/37/38-5-2 | | Safety Statements | 26-36-37/39-36/37/39-35 | | RIDADR | 1325 | | WGK Germany | 3 | | F | 8-10-21 | | Hazard Note | Irritant/Flammable | | HS Code | 2933 99 80 | | HazardClass | 4.1 | | PackingGroup | Ⅱ | | Storage Class | 4.1A - Other explosive hazardous materials | | Hazard Classifications | Flam. Sol. 1
Skin Sens. 1A |
| Chemical Properties | TBTU [chemical name:2-(1H-Benzotriazole-1-yl)-1,1,3,3-tetramethyluronium tetrafluoroborate] is WHITE TO PALE CREAM FINE CRYSTALLINE POWDER | | Uses | TBTU is a coupling reagent for peptide synthesis causing low racemization, which is ideally suited for solid-phase peptide synthesis. Also used in the synthesis of acid based t-antigen glycodendrimers. | | reaction suitability | reaction type: Coupling Reactions |
| | TBTU Preparation Products And Raw materials |
|