|
|
| | BOC-L-4-THIAZOLYLALANINE Basic information |
| | BOC-L-4-THIAZOLYLALANINE Chemical Properties |
| Melting point | 122℃ | | Boiling point | 456.8±40.0 °C(Predicted) | | density | 1.288 | | refractive index | 1.5650 (estimate) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | form | Powder | | pka | 3.53±0.10(Predicted) | | color | White to pale yellow-beige | | Major Application | peptide synthesis | | InChI | 1S/C11H16N2O4S/c1-11(2,3)17-10(16)13-8(9(14)15)4-7-5-18-6-12-7/h5-6,8H,4H2,1-3H3,(H,13,16)(H,14,15)/t8-/m0/s1 | | InChIKey | RVXBTZJECMMZSB-QMMMGPOBSA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cscn1)C(O)=O | | CAS DataBase Reference | 119434-75-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29223900 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ACROS
| English |
| | BOC-L-4-THIAZOLYLALANINE Usage And Synthesis |
| Chemical Properties | White to pale yellowish-beige powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-L-4-THIAZOLYLALANINE Preparation Products And Raw materials |
|