| Company Name: |
Beijing Ouhe Technology Co., Ltd
|
| Tel: |
13552068683 13522913783 |
| Email: |
2355560935@qq.com |
| Products Intro: |
Product Name:DI-4-ANEPPS
CAS:90134-00-2
Purity:98.00% Package:5 mg
|
| Company Name: |
Shanghai Macklin Biochemical Co.,Ltd.
|
| Tel: |
15221275939; 15221275939 |
| Email: |
shenlinxing@macklin.cn |
| Products Intro: |
Product Name:Di-4-ANEPPS
CAS:90134-00-2
Purity:95%(HPLC) Package:5mg；25mg；250mg
|
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Products Intro: |
Product Name:Di-4-ANEPPS
CAS:90134-00-2
Purity:98% Package:1g;10g;100g;1KG;5KG
|
|
| | DI-4-ANEPPS Basic information |
| Product Name: | DI-4-ANEPPS | | Synonyms: | NEURODYE DI-4-ANEPPS;1-(3-sulfonatopropyl)-4-(beta)(2-(di-n-butylamino)-6-naphthylvinyl)pyridiniumb;4-(2-(6-(DIBUTYLAMINO)-2-NAPHTHALENYL)ETHENYL)-1-(3-SULFOPROPYL)PYRIDINIUM HYDROXIDE INNER SALT;6-[2-(n,n-dibutylamino)naphthyl]ethenyl-
40-pyridinium Propanesulfonate;Jpw 211;1-(3-
sulfonatopropyl)4-[b-[2-(di-n-butylamino)-6-naphthyl]
vinyl]pyridinium Betaine;DI-4-ANEPPS;1-(3-sulfonatopropyl)-4-(beta)(2-(di-n-butylamino)-6-naphthylvinyl)pyridinium betaine | | CAS: | 90134-00-2 | | MF: | C28H36N2O3S | | MW: | 480.66 | | EINECS: | | | Product Categories: | Styryl | | Mol File: | 90134-00-2.mol |  |
| | DI-4-ANEPPS Chemical Properties |
| Melting point | 122–124℃ | | storage temp. | 2-8°C | | solubility | DMF: soluble | | form | powder | | color | orange to red | | Appearance | Orange solid | | ex/em | 483/686 nm (artificial membrane) | | λmax | 495 nm | | ε(extinction coefficient) | ≥38000 at 493-499nm in methanol | | Major Application | diagnostic assay manufacturing
hematology
histology | | Biological Applications | Measuring membrane potential; preventing arrhythmias; probes for Na,K-ATPase reaction mechanism; assays for identifying tastespecific genes; quantum dots | | InChI | 1S/C28H36N2O3S/c1-3-5-17-30(18-6-4-2)28-13-12-26-22-25(10-11-27(26)23-28)9-8-24-14-19-29(20-15-24)16-7-21-34(31,32)33/h8-15,19-20,22-23H,3-7,16-18,21H2,1-2H3 | | InChIKey | HAPJROQJVSPKCJ-UHFFFAOYSA-N | | SMILES | CCCCN(CCCC)c1ccc2cc(\C=C\c3cc[n+](CCCS([O-])(=O)=O)cc3)ccc2c1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | DI-4-ANEPPS Usage And Synthesis |
| Description | Di-4-ANEPPS is a potentiometric fluorescent dye that can be used to measure membrane potential. It displays absorption/emission maxima of 495/705 nm, respectively. The relative fluorescence changes proportionally to membrane potential at a rate of approximately 10% per 100 mV. Di-4-ANEPPS has been used to measure membrane potential in a variety of tissue and cell types as well as artificial membranes. | | Chemical Properties | Appearance: Orange-red solid
ex/em: 483/686 nm (artificial membrane)
Extinction coefficient (ε): 39,000 Lmol1cm1 (methanol) | | Uses | Di-4-ANEPPS is a membrane potential dye which responds to changes in membrane potential monitored by fluorescence excitation changes. It is correlated to changes in the membrane potential of a cell. Dyes and metabolites. | | storage | Store at -20°C | | References | [1] L M LOEW. A naphthyl analog of the aminostyryl pyridinium class of potentiometric membrane dyes shows consistent sensitivity in a variety of tissue, cell, and model membrane preparations.[J]. Journal of Membrane Biology, 1992, 130 1: 1-10. DOI: 10.1007/bf00233734 | | Abs/Em Maxima | 493/708 nm |
| | DI-4-ANEPPS Preparation Products And Raw materials |
|