|
|
| | 2-Biphenylcarboxaldehyde Basic information |
| | 2-Biphenylcarboxaldehyde Chemical Properties |
| Melting point | 202 °C | | Boiling point | 91-92 °C/0.15 mmHg (lit.) | | density | 1.130 g/mL at 25 °C (lit.) | | refractive index | n20/D >1.6220(lit.) | | Fp | 215 °F | | storage temp. | 2-8°C | | solubility | Chloroform, Ethyl Acetate | | form | Clear Liquid | | Appearance | Colorless to off-white Solid-Liquid Mixture | | InChI | InChI=1S/C13H10O/c14-10-12-8-4-5-9-13(12)11-6-2-1-3-7-11/h1-10H | | InChIKey | LCRCBXLHWTVPEQ-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)=CC=CC=C1C=O | | CAS DataBase Reference | 1203-68-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | DV1771000 | | HS Code | 29122990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | | Toxicity | mouse,LD50,unreported,> 1500mg/kg (1500mg/kg),Farmaco, Edizione Scientifica. Vol. 19, Pg. 964, 1964. |
| | 2-Biphenylcarboxaldehyde Usage And Synthesis |
| Chemical Properties | 2-Biphenylcarboxaldehyde is Clear Liquid | | Uses | 2-Biphenylcarboxaldehyde is a reactant used in the preparation of imidazoquinoline derivatives, a class of microsomal prostaglandin E2 synthase-1 inhibitors. 2-Biphenylcarboxaldehyde is also used in the p reparation of phenoxybenzylamino carboline derivatives as potential antitumor drugs targeting α-tubulin. | | Uses | Biphenyl-2-carboxaldehyde may be used in the preparation of 9-ethylthiofluorene. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 54, p. 1523, 1989 DOI: 10.1021/jo00268a009 | | General Description | Biphenyl-2-carboxaldehyde is an oxygen-containing polycyclic aromatic hydrocarbon derivative (OPAH). It can be prepared via Suzuki cross-coupling reaction between phenyl boronic acid and 2-bromobenzaldehyde. |
| | 2-Biphenylcarboxaldehyde Preparation Products And Raw materials |
|