| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:1,10-Phenanthroline-d8
CAS:90412-47-8
Remarks:CS-C-00539
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:1,10-Phenanthroline-d8
CAS:90412-47-8
Purity:98 atom % D Package:500MG Remarks:491055-500MG
|
| Company Name: |
Clearsynth Canada Inc.
|
| Tel: |
+1.415.685.4395 |
| Email: |
enquiry@clearsynth.com |
| Products Intro: |
Product Name:1,10-Phenanthroline-d8
CAS:90412-47-8
Remarks:CS-BX-00275
|
|
| | 1,10-PHENANTHROLINE-D8 Basic information |
| Product Name: | 1,10-PHENANTHROLINE-D8 | | Synonyms: | 1,10-PHENANTHROLINE-D8;1,10-PHENANTHROLINE-D8, 98 ATOM % D;o-Phenanthroline-d8;2,3,4,5,6,7,8,9-octadeuterio-1,10-phenanthroline;1,10-Phenanthroline-d?;1,10-Phenanthroline-d8 | | CAS: | 90412-47-8 | | MF: | C12H8N2 | | MW: | 180.21 | | EINECS: | | | Product Categories: | Alphabetical Listings;P;Stable Isotopes | | Mol File: | 90412-47-8.mol |  |
| | 1,10-PHENANTHROLINE-D8 Chemical Properties |
| Melting point | 114-117 °C(lit.) | | form | solid | | InChI | 1S/C12H8N2/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1/h1-8H/i1D,2D,3D,4D,5D,6D,7D,8D | | InChIKey | DGEZNRSVGBDHLK-PGRXLJNUSA-N | | SMILES | [2H]c1nc2c3nc([2H])c([2H])c([2H])c3c([2H])c([2H])c2c([2H])c1[2H] |
| Hazard Codes | T,N | | Risk Statements | 25-50/53 | | Safety Statements | 45-60-61 | | RIDADR | UN 2811 6.1/PG 2 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Aquatic Acute 1
Aquatic Chronic 1 |
| | 1,10-PHENANTHROLINE-D8 Usage And Synthesis |
| Uses | 1,10-Phenanthroline-d8 (CAS# 90412-47-8) is a useful isotopically labeled research compound. |
| | 1,10-PHENANTHROLINE-D8 Preparation Products And Raw materials |
|