|
|
| | 4-METHYLIMIDAZOLIDINE-2-THIONE Basic information |
| | 4-METHYLIMIDAZOLIDINE-2-THIONE Chemical Properties |
| Melting point | 102-104 °C | | Boiling point | 157.3±23.0 °C(Predicted) | | density | 1.095 (estimate) | | refractive index | 1.5000 (estimate) | | storage temp. | Refrigerator | | solubility | Chloroform (Sparingly, Sonicated), Methanol (Slightly) | | pka | 15.35±0.40(Predicted) | | color | White to Beige | | Major Application | agriculture
environmental | | InChI | InChI=1S/C4H8N2S/c1-3-2-5-4(7)6-3/h3H,2H2,1H3,(H2,5,6,7) | | InChIKey | NGZJXCFNBVJLQN-UHFFFAOYSA-N | | SMILES | C1(=S)NCC(C)N1 | | EPA Substance Registry System | 2-Imidazolidinethione, 4-methyl- (2122-19-2) |
| Hazard Codes | Xn | | Risk Statements | 22-52/53-63 | | Safety Statements | 36/37-46-61 | | WGK Germany | 3 | | RTECS | NJ0400000 | | HS Code | 2933299090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 3
Repr. 2 |
| | 4-METHYLIMIDAZOLIDINE-2-THIONE Usage And Synthesis |
| Uses | N,N''-(1,2-Propylene)thiourea is an intermediate used in various organic chemical reactions such as the preparation of aryl 2-Iminoimidazoline derivatives. | | Uses | 4-METHYLIMIDAZOLIDINE-2-THIONE is an intermediate used in various organic chemical reactions such as the preparation of aryl 2-Iminoimidazoline derivatives. |
| | 4-METHYLIMIDAZOLIDINE-2-THIONE Preparation Products And Raw materials |
|