| Company Name: |
Foshan Treasure Biotechnology Co., Ltd Gold
|
| Tel: |
0757-85921206 18520245316 |
| Email: |
2329783215@qq.com |
| Products Intro: |
Product Name:Amlodipine Impurity 4 CAS:107812-86-2 Purity:99% HPLC Package:20mg;50mg;100mg;1g
|
| Company Name: |
Nanjing XiZe Biotechnology CO., Ltd.
|
| Tel: |
025-66023220 15250997978 |
| Email: |
1511893459@qq.com |
| Products Intro: |
Product Name:Amlodipine Impurity 26 CAS:107812-86-2 Purity:95% HPLC Package:10mg;25mg;50mg;100mg;250mg;500mg;1g
|
| Company Name: |
PI & PI BIOTECH INC.
|
| Tel: |
+86-13602409664 +86-17788709170 |
| Email: |
Sales@pipitech.com |
| Products Intro: |
Product Name:Amlodipine Impurity 4 CAS:107812-86-2 Purity:90%+ HPLC Package:10mg;25mg;50mg;100mg Remarks:C18H19Cl2NO4
|
|
| | Amlodipine Impurity 26 Basic information |
| Product Name: | Amlodipine Impurity 26 | | Synonyms: | Amlodipine Impurity 4;Amlodipine Impurity 57;3,5-Pyridinedicarboxylic acid, 2-(chloromethyl)-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-, 3-ethyl 5-methyl ester;Amlodipine Impurity 26;Amlodipine Impurity 102 | | CAS: | 107812-86-2 | | MF: | C18H19Cl2NO4 | | MW: | 384.25 | | EINECS: | | | Product Categories: | | | Mol File: | 107812-86-2.mol |  |
| | Amlodipine Impurity 26 Chemical Properties |
| InChI | InChI=1S/C18H19Cl2NO4/c1-4-25-18(23)16-13(9-19)21-10(2)14(17(22)24-3)15(16)11-7-5-6-8-12(11)20/h5-8,15,21H,4,9H2,1-3H3 | | InChIKey | ZLBUAOXROCJPCF-UHFFFAOYSA-N | | SMILES | C1(CCl)NC(C)=C(C(OC)=O)C(C2=CC=CC=C2Cl)C=1C(OCC)=O |
| | Amlodipine Impurity 26 Usage And Synthesis |
| | Amlodipine Impurity 26 Preparation Products And Raw materials |
|