|
|
| | 2,6-DIIODO-4-NITROANILINE Basic information |
| | 2,6-DIIODO-4-NITROANILINE Chemical Properties |
| Melting point | 251-253 °C (lit.) | | Boiling point | 430.8±45.0 °C(Predicted) | | density | 2.5050 (estimate) | | storage temp. | 2-8°C, protect from light | | form | powder to crystal | | pka | -3.43±0.20(Predicted) | | color | Light yellow to Amber to Dark green | | λmax | 345nm(Diethyl ether)(lit.) | | InChI | 1S/C6H4I2N2O2/c7-4-1-3(10(11)12)2-5(8)6(4)9/h1-2H,9H2 | | InChIKey | YPVYMWQYENWFAT-UHFFFAOYSA-N | | SMILES | Nc1c(I)cc(cc1I)[N+]([O-])=O | | CAS DataBase Reference | 5398-27-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 2921.42.9000 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,6-DIIODO-4-NITROANILINE Usage And Synthesis |
| Chemical Properties | yellow to green crystalline powder |
| | 2,6-DIIODO-4-NITROANILINE Preparation Products And Raw materials |
|