|
|
| | 2-(TRI-N-BUTYLSTANNYL)OXAZOLE Basic information |
| | 2-(TRI-N-BUTYLSTANNYL)OXAZOLE Chemical Properties |
| Melting point | 227-228℃ | | Boiling point | 108-110 °C0.2 mm Hg(lit.) | | density | 1.71 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4930(lit.) | | Fp | >230 °F | | storage temp. | Storage temp. 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | liquid | | pka | 1.04±0.10(Predicted) | | color | Colourless | | Water Solubility | Insoluble in water. | | InChI | 1S/3C4H9.C3H2NO.Sn/c3*1-3-4-2;1-2-5-3-4-1;/h3*1,3-4H2,2H3;1-2H; | | InChIKey | YOWGRWHKDCHINP-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)c1ncco1 |
| Hazard Codes | T,N | | Risk Statements | 21-25-36/38-48/23/25-50/53 | | Safety Statements | 35-36/37/39-45-60-61 | | RIDADR | UN 2788 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | 6.1 | | HS Code | 29349990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |
| | 2-(TRI-N-BUTYLSTANNYL)OXAZOLE Usage And Synthesis |
| Uses | 2-(Tri-n-butylstannyl)oxazole act as a synthetic building block, which is utilized in Stille coupling | | General Description | 2-(Tri-n-butylstannyl)oxazole is a synthetic building block used in Stille coupling reaction. |
| | 2-(TRI-N-BUTYLSTANNYL)OXAZOLE Preparation Products And Raw materials |
|