|
|
| | DESMETHYL MIRTAZAPINE Basic information |
| Product Name: | DESMETHYL MIRTAZAPINE | | Synonyms: | Desmethyl Mirtazapine
Discontinued See: D292074;N-Desmethylmirtazapine;Mirtazapine Related Compound A (15 mg) (1,2,3,4,10,14b-hexahydropyrazino[2,1-a]pyrido[2,3-c][2]benzazepine);1,2,3,4,10,14b-Hexahydro-pyrazino[2,1-a]pyrido[2,3-c][2]benzazepine N-DeMethylMirtazapine;N-DesMethyl Mirtazepine;Mirtazapine EP IMpurity D (USP RC A);N-Desmethylmirtazapine solution;N-Demethylmirtazapine | | CAS: | 61337-68-6 | | MF: | C16H17N3 | | MW: | 251.33 | | EINECS: | 200-835-2 | | Product Categories: | Heterocycles. Metabolites & Impurities;Metabolites & Impurities;Various Metabolites and Impurities;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 61337-68-6.mol |  |
| | DESMETHYL MIRTAZAPINE Chemical Properties |
| Melting point | >195C (dec.) | | Boiling point | 456.1±33.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | Fp | 2℃ | | storage temp. | -20°C | | solubility | Methanol (Slightly), Water (Slightly) | | form | liquid | | pka | 9.00±0.20(Predicted) | | BRN | 3976057 | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C16H17N3/c1-2-6-14-12(4-1)10-13-5-3-7-18-16(13)19-9-8-17-11-15(14)19/h1-7,15,17H,8-11H2 | | InChIKey | FGLAMNFOHWVQOH-UHFFFAOYSA-N | | SMILES | N12CCNCC1C1=CC=CC=C1CC1=CC=CN=C21 |
| Hazard Codes | F,Xn | | Risk Statements | 11-20/21/22-36 | | Safety Statements | 16-36/37 | | RIDADR | UN 1648 3 / PGII | | WGK Germany | 2 | | HS Code | 2933599550 | | Storage Class | 13 - Non Combustible Solids |
| | DESMETHYL MIRTAZAPINE Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A metabolite of Mirtazapine, a2-Adrenergic blocker. | | Uses | A metabolite of Mirtazapine, α2-adrenergic blocker. | | Definition | ChEBI: N-demethylmirtazapine is a benzazepine metabolite resulting from demethylation of the antidpressant, mirtazapine. It has a role as a human xenobiotic metabolite, an alpha-adrenergic antagonist, an anxiolytic drug, a H1-receptor antagonist, a histamine antagonist and a serotonergic antagonist. It is a tetracyclic antidepressant and a benzazepine. |
| | DESMETHYL MIRTAZAPINE Preparation Products And Raw materials |
|