| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:p-Xylene-d6 CAS:25493-13-4 Remarks:CS-C-00617
|
| Company Name: |
Nanjing Haolv Biotechnology Co.,Ltd
|
| Tel: |
025-84622273 17361806303 |
| Email: |
kexin.zhou@haolvbiotech.com |
| Products Intro: |
Product Name:p-Xylene-α,α,α,α',α',α'-d6 CAS:25493-13-4 Purity:98% Package:5g;25g;100g Remarks:Environmental Standards
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:p-Xylene-α,α,α,α’,α’,α’-d6 CAS:25493-13-4 Purity:NULL Package:100mg;1g;2.5g;250mg;500mg;50mg Remarks:NULL
|
|
| | P-XYLENE-ALPHA,ALPHA,ALPHA,ALPHA',ALPHA',ALPHA'-D6 Basic information |
| Product Name: | P-XYLENE-ALPHA,ALPHA,ALPHA,ALPHA',ALPHA',ALPHA'-D6 | | Synonyms: | Benzene,1,4-di(methyl-d3)-;P-xylene-alpha,alpha,alpha,alpha,alpha;p-Xylene-alpha,alpha-d6,98 atom % D;(alpha,alpha,alpha,alpha',alpha',alpha'-2H6)p-xylene;P-XYLENE-ALPHA,ALPHA’-D6 98%;p-xylene-alpha,alphad6;1,4-dimethyl-d6-benzene;1,4-Di(methyl-d3)benzene. | | CAS: | 25493-13-4 | | MF: | C8H4D6 | | MW: | 112.2 | | EINECS: | 247-033-9 | | Product Categories: | | | Mol File: | 25493-13-4.mol |  |
| | P-XYLENE-ALPHA,ALPHA,ALPHA,ALPHA',ALPHA',ALPHA'-D6 Chemical Properties |
| Melting point | 13 °C | | Boiling point | 135.4 °C(lit.) | | density | 0.915 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4944(lit.) | | Fp | 86 °F | | storage temp. | Flammables area | | form | Liquid | | color | Clear colorless | | InChI | 1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3/i1D3,2D3 | | InChIKey | URLKBWYHVLBVBO-WFGJKAKNSA-N | | SMILES | [2H]C([2H])([2H])c1ccc(cc1)C([2H])([2H])[2H] | | CAS Number Unlabeled | 106-42-3 |
| Hazard Codes | Xn | | Risk Statements | 10-20/21-38 | | Safety Statements | 25 | | RIDADR | UN 1307 3/PG 3 | | WGK Germany | 2 | | HS Code | 2845901000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Aquatic Chronic 3 Asp. Tox. 1 Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | P-XYLENE-ALPHA,ALPHA,ALPHA,ALPHA',ALPHA',ALPHA'-D6 Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | p-Xylene-α,α,α,α',α',α'-d6 is the labelled analog of p-Xylene (X749410) which is a colorless organic solvent used in the production of benzoic, isophthalic and tetraphillic acids. p-Xylene-α,α,α,α',α',α'-d6 was used in study to investigate the effects on solution electron affinity due to deuteration on methyl groups vs ring deuteration on p-xylene. |
| | P-XYLENE-ALPHA,ALPHA,ALPHA,ALPHA',ALPHA',ALPHA'-D6 Preparation Products And Raw materials |
|