- Boc-L-Arg-OH
-
-
2026-07-24
- CAS:13726-76-6
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- BOC-ARG-OH
-
- $1.10
-
2025-06-25
- CAS:13726-76-6
- Min. Order: 1g
- Purity: 99.0% min
- Supply Ability: 100 tons min
- BOC-ARG-OH
-
- $7.00
-
2019-09-02
- CAS: 13726-76-6
- Min. Order: 1KG
- Purity: 99%
|
| | BOC-ARG-OH Basic information |
| Product Name: | BOC-ARG-OH | | Synonyms: | N-TERT-BUTOXYCARBONYL-L-ARGININE;N-T-BOC-L-ARGININE;N-ALPHA-T-BOC-L-ARG;N-ALPHA-T-BUTOXYCARBONYL-L-ARGININE;NALPHA-(TERT-BUTOXYCARBONYL)-L-ARGININE;BOC-L-ARGININE;BOC-ARGININE;BOC-ARG-OH | | CAS: | 13726-76-6 | | MF: | C11H22N4O4 | | MW: | 274.32 | | EINECS: | 237-295-2 | | Product Categories: | | | Mol File: | 13726-76-6.mol |  |
| | BOC-ARG-OH Chemical Properties |
| Melting point | 117-119 °C | | density | 1.28±0.1 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMF: 15mg/mL,DMSO: 15mg/mL,Ethanol: 15mg/mL,PBS (pH 7.2): 10mg/mL | | form | A solid | | pka | 3.92±0.21(Predicted) | | color | White to off-white | | Optical Rotation | [α]20/D 6.5°, c = 1 in acetic acid | | BRN | 2419628 | | Major Application | peptide synthesis | | InChI | 1S/C11H22N4O4/c1-11(2,3)19-10(18)15-7(8(16)17)5-4-6-14-9(12)13/h7H,4-6H2,1-3H3,(H,15,18)(H,16,17)(H4,12,13,14)/t7-/m0/s1 | | InChIKey | HSQIYOPBCOPMSS-ZETCQYMHSA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](CCCNC(N)=N)C(O)=O | | CAS DataBase Reference | 13726-76-6(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29252900 | | Storage Class | 11 - Combustible Solids |
| | BOC-ARG-OH Usage And Synthesis |
| Chemical Properties | White to yellow solid | | Uses | Boc-Arg-OH is a nucleic acid carrier and a peptide that functions in the delivery systems of genes. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-ARG-OH Preparation Products And Raw materials |
|