|
|
| | 2,3,5,6-TETRAFLUORO-4-(TRIFLUOROMETHYL)PHENOL Basic information |
| Product Name: | 2,3,5,6-TETRAFLUORO-4-(TRIFLUOROMETHYL)PHENOL | | Synonyms: | TETRAFLUORO-4-(TRIFLUOROMETHYL)PHENOL;TETRAFLUORO-4-(TRIFLUOROMETHYL)PHENOLE;PERFLUORO-P-CRESOL;2,3,5,6-TETRAFLUORO-4-HYDROXYBENZOTRIFLUORIDE;2,3,5,6-TETRAFLUORO-4-(TRIFLUOROMETHYL)PHENOL;ALPHA,ALPHA,ALPHA,2,3,5,6-HEPTAFLUORO-P-CRESOL;4-HYDROXY-2,3,5,6-TETRAFLUOROBENZOTRIFLUORIDE;TeF0M778 | | CAS: | 2787-79-3 | | MF: | C7HF7O | | MW: | 234.07 | | EINECS: | | | Product Categories: | Aryl Fluorinated Building Blocks;Building Blocks;C6 to C8;C7-C8;Chemical Synthesis;Fluorinated Building Blocks;Organic Building Blocks;Oxygen Compounds;Phenols;Organic Building Blocks;Organic Fluorinated Building Blocks;Other Fluorinated Organic Building Blocks;Oxygen Compounds | | Mol File: | 2787-79-3.mol |  |
| | 2,3,5,6-TETRAFLUORO-4-(TRIFLUOROMETHYL)PHENOL Chemical Properties |
| Melting point | 25°C | | Boiling point | 163-164 °C (lit.) | | density | 1.713 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.414(lit.) | | Fp | 179 °F | | storage temp. | 2-8°C | | pka | 4.09±0.33(Predicted) | | form | powder to lump to clear liquid | | color | White or Colorless to Almost white or Almost colorless | | InChI | 1S/C7HF7O/c8-2-1(7(12,13)14)3(9)5(11)6(15)4(2)10/h15H | | InChIKey | HZQGKHUTYHEFBT-UHFFFAOYSA-N | | SMILES | Oc1c(F)c(F)c(c(F)c1F)C(F)(F)F | | CAS DataBase Reference | 2787-79-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | IRRITANT, IRRITANT-HARMFUL | | HS Code | 29081990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,3,5,6-TETRAFLUORO-4-(TRIFLUOROMETHYL)PHENOL Usage And Synthesis |
| Uses | 2,3,5,6-Tetrafluoro-4-(trifluoromethyl)phenol (Perfluoro-p-cresol), an organofluorine compound, is an aryl fluorinated building block. It is a colorless liquid having hygroscopic properties and a faintly phenolic odor. It has been prepared by using octafluorotoluene as starting reagent. Various physical properties (density, refractive index, freezing point and boiling point) of 2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenol have been reported. | | General Description | 2,3,5,6-Tetrafluoro-4-(trifluoromethyl)phenol (Perfluoro-p-cresol), an organofluorine compound, is an aryl fluorinated building block. It is a colorless liquid having hygroscopic properties and a faintly phenolic odor. It has been prepared by using octafluorotoluene as starting reagent. Various physical properties (density, refractive index, freezing point and boiling point) of 2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenol have been reported. |
| | 2,3,5,6-TETRAFLUORO-4-(TRIFLUOROMETHYL)PHENOL Preparation Products And Raw materials |
|