|
|
| | N-Acetyl-DL-tryptophan Basic information |
| | N-Acetyl-DL-tryptophan Chemical Properties |
| Melting point | 204-206 °C (dec.) (lit.) | | alpha | -0.5～+0.5°(20℃/D)(c=2,C2H5OH) | | Boiling point | 389.26°C (rough estimate) | | density | 1.1855 (rough estimate) | | vapor pressure | <0.00005 mPa ( 20 °C) | | refractive index | 1.6450 (estimate) | | storage temp. | 2-8°C | | solubility | Slightly soluble in water, very soluble in ethanol (96 per cent). It dissolves in dilute solutions of alkali hydroxides. | | pka | 3.65±0.10(Predicted) | | form | Powder | | color | White to light yellow | | PH | 3.25 (20°C, 0.5g/L in H2O) | | biological source | synthetic | | Water Solubility | INSOLUBLE IN COLD WATER | | BRN | 89478 | | Stability: | Stable. Incompatible with strong oxidizing agents. | | Major Application | liquid formulation
parenterals
pharma/biopharma processes | | InChI | 1S/C13H14N2O3/c1-8(16)15-12(13(17)18)6-9-7-14-11-5-3-2-4-10(9)11/h2-5,7,12,14H,6H2,1H3,(H,15,16)(H,17,18) | | InChIKey | DZTHIGRZJZPRDV-UHFFFAOYSA-N | | SMILES | CC(=O)NC(Cc1c[nH]c2ccccc12)C(O)=O | | LogP | -0.408 (est) | | CAS DataBase Reference | 87-32-1(CAS DataBase Reference) | | NIST Chemistry Reference | Acetyl-dl-tryptophan(87-32-1) | | EPA Substance Registry System | Tryptophan, N-acetyl- (87-32-1) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | Hazard Note | Keep Cold | | TSCA | TSCA listed | | HS Code | 29339990 | | Storage Class | 11 - Combustible Solids |
| | N-Acetyl-DL-tryptophan Usage And Synthesis |
| Chemical Properties | white powder | | Uses | N-Acetyl-DL-tryptophan is produced via chemical synthesis using the standard amino acid, tryptophan. It can be used in downstream applications of biopharmaceutical production as a transfer agent or stabilizer. | | Definition | ChEBI: An N-acetylamino acid that is the N-acetyl derivative of tryptophan. | | Flammability and Explosibility | Not classified | | Purification Methods | A likely impurity is tryptophan. Crystallise it from EtOH by adding water. [Cowgill Biochim Biophys Acta 200 18 1970, DL: Berg J Biol Chem 100 79 1933, Beilstein 22/14 V 40-50.] |
| | N-Acetyl-DL-tryptophan Preparation Products And Raw materials |
|