|
|
| | METHYL 1-HYDROXY-2-NAPHTHOATE Basic information |
| | METHYL 1-HYDROXY-2-NAPHTHOATE Chemical Properties |
| Melting point | 76-80 °C (lit.) | | Boiling point | 330.5±15.0 °C(Predicted) | | density | 1.264±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 8.09±0.50(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C12H10O3/c1-15-12(14)10-7-6-8-4-2-3-5-9(8)11(10)13/h2-7,13H,1H3 | | InChIKey | HMIBDRSTVGFJPB-UHFFFAOYSA-N | | SMILES | C1(O)=C2C(C=CC=C2)=CC=C1C(OC)=O | | EPA Substance Registry System | 2-Naphthalenecarboxylic acid, 1-hydroxy-, methyl ester (948-03-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2918290090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | METHYL 1-HYDROXY-2-NAPHTHOATE Usage And Synthesis |
| Uses | Methyl 1-hydroxy-2-naphthoate may be used as a starting reagent for the synthesis of axially chiral benzimidazole derivatives. It may also be employed in the synthesis of the following aza-mollugin derivatives:
- azamollugin
- 2-desmethyl-azamollugin
- 2,2-didesmethyl-azamollugin
| | General Description | The asymmetric unit of the crystal of methyl 1-hydroxy-2-naphthoate contains two independent planar molecules that exhibit intra-molecular hydrogen bonds. Methyl 1-hydroxy-2-naphthoate can be prepared from 1-hydroxy-2-naphthoic acid, via esterification. |
| | METHYL 1-HYDROXY-2-NAPHTHOATE Preparation Products And Raw materials |
|