| Company Name: |
Hubei Xinyang Medical Technology Co., Ltd
|
| Tel: |
15347293736 |
| Email: |
2853117764@yongstandards.com |
| Products Intro: |
Product Name:14-Episinomenine
CAS:60761-53-7
Purity:99% HPLC Package:10mg;25mg;50mg;100mg;200mg;500mg
|
|
| | Morphinan-6-one, 7,8-didehydro-4-hydroxy-3,7-dimethoxy-17-methyl-, (9α,13α)- Basic information |
| Product Name: | Morphinan-6-one, 7,8-didehydro-4-hydroxy-3,7-dimethoxy-17-methyl-, (9α,13α)- | | Synonyms: | Morphinan-6-one, 7,8-didehydro-4-hydroxy-3,7-dimethoxy-17-methyl-, (9α,13α)- | | CAS: | 60761-53-7 | | MF: | C19H23NO4 | | MW: | 329.39 | | EINECS: | | | Product Categories: | | | Mol File: | 60761-53-7.mol |  |
| | Morphinan-6-one, 7,8-didehydro-4-hydroxy-3,7-dimethoxy-17-methyl-, (9α,13α)- Chemical Properties |
| Melting point | 101-103 °C(Solv: acetone (67-64-1)) | | Boiling point | 513.6±50.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | pka | 9.72±0.40(Predicted) | | InChI | InChI=1S/C19H23NO4/c1-20-7-6-19-10-14(21)16(24-3)9-12(19)13(20)8-11-4-5-15(23-2)18(22)17(11)19/h4-5,9,12-13,22H,6-8,10H2,1-3H3/t12-,13-,19+/m0/s1 | | InChIKey | INYYVPJSBIVGPH-WTOJCKNJSA-N | | SMILES | C1=C2C([C@@]34CCN(C)[C@@]([H])(C2)[C@]3([H])C=C(OC)C(=O)C4)=C(O)C(OC)=C1 |
| | Morphinan-6-one, 7,8-didehydro-4-hydroxy-3,7-dimethoxy-17-methyl-, (9α,13α)- Usage And Synthesis |
| Uses | 14-Episinomenine is an alkaloid that can be isolated from Stephania cepharantha[1]. | | References | [1] KASHIWABA, N., et al. Alkaloidal Constituents of the Tubers of Stephania cepharantha Cultivated in Japan: Structure of 3,4-Dehydrocycleanine, a New Bisbenzylisoquinoline Alkaloid. CHEMICAL & PHARMACEUTICAL BULLETIN. 1997, 45(3), 470–475. |
| | Morphinan-6-one, 7,8-didehydro-4-hydroxy-3,7-dimethoxy-17-methyl-, (9α,13α)- Preparation Products And Raw materials |
|