| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(1R,2R)-(?)-N-Boc-2-aMino-1-(4-nitrophenyl)-1,3-propanediol CAS:366487-74-3 Purity:96% Package:1G,5G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:(1R,2R)-(-)-N-Boc-2-amino-1-(4-nitrophenyl)-1,3-propanediol CAS:366487-74-3 Purity:96% Package:5G Remarks:660213-5G
|
| Company Name: |
Amatek Scientific Co. Ltd.
|
| Tel: |
0512-56316828 4008675858 |
| Email: |
sales1@amateksci.com |
| Products Intro: |
Product Name:(1R,2R)-2-(N-Boc-amino)-1-(4-nitrophenyl)-1,3-propanediol CAS:366487-74-3 Purity:97% HPLC Package:1g;5g;25g;100g
|
|
| | N-BOC-(1R,2R)-(-)-2-AMINO-1-(4-NITROPHE& Basic information |
| Product Name: | N-BOC-(1R,2R)-(-)-2-AMINO-1-(4-NITROPHE& | | Synonyms: | tert-butyl (1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-ylcarbaMate;(1R,2R)-()-N-Boc-2-aMino-1-(4-nitrophenyl)-1,3-propanediol;N-BOC-(1R,2R)-(-)-2-AMINO-1-(4-NITROPHE& USP/EP/BP;ert-butylN-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]carbamate;((1R,2R)-2-[N-(tert-butoxycarbonyl)amino]-1-(4-nitrophenyl)-1,3-propanodiol);Carbamic acid, N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]-, 1,1-dimethylethyl ester;(1R,2R)-2-(N-Boc-amino)-1-(4-nitrophenyl)-1,3-propanediol;(1R,2R)-(?)-N-Boc-2-amino-1-(4-nitrophenyl)-1,3-propanediol | | CAS: | 366487-74-3 | | MF: | C14H20N2O6 | | MW: | 312.32 | | EINECS: | | | Product Categories: | Amino Alcohols;Chiral Building Blocks;Organic Building Blocks | | Mol File: | 366487-74-3.mol |  |
| | N-BOC-(1R,2R)-(-)-2-AMINO-1-(4-NITROPHE& Chemical Properties |
| Melting point | 115-119 °C | | Boiling point | 524.9±50.0 °C(Predicted) | | density | 1.292±0.06 g/cm3(Predicted) | | pka | 11.38±0.46(Predicted) | | form | solid | | InChI | 1S/C14H20N2O6/c1-14(2,3)22-13(19)15-11(8-17)12(18)9-4-6-10(7-5-9)16(20)21/h4-7,11-12,17-18H,8H2,1-3H3,(H,15,19)/t11-,12-/m1/s1 | | InChIKey | VQYVJTCEEOYKHE-VXGBXAGGSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](CO)[C@H](O)c1ccc(cc1)[N+]([O-])=O |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | N-BOC-(1R,2R)-(-)-2-AMINO-1-(4-NITROPHE& Usage And Synthesis |
| | N-BOC-(1R,2R)-(-)-2-AMINO-1-(4-NITROPHE& Preparation Products And Raw materials |
|