|
|
| | Boronic acid, [4-(difluoromethoxy)phenyl]- (9CI) Basic information |
| Product Name: | Boronic acid, [4-(difluoromethoxy)phenyl]- (9CI) | | Synonyms: | Boronic acid, [4-(difluoromethoxy)phenyl]- (9CI);4-(Difluoromethoxy)-phenylboronic acid;4-Borono-alpha,alpha-difluoroanisole;B-[4-(Difluoromethoxy)phenyl]boronic acid;Boronic acid, B-[4-(difluoromethoxy)phenyl]-;Boronic acid, B-[4-(difluorom;(4-(Difluoromethoxy)phenyl)boronicaci;4-(Difluoromethoxy)-phenylboronic acid contain 0.5% water | | CAS: | 688810-12-0 | | MF: | C7H7BF2O3 | | MW: | 187.94 | | EINECS: | | | Product Categories: | BORONICACID | | Mol File: | 688810-12-0.mol | ![Boronic acid, [4-(difluoromethoxy)phenyl]- (9CI) Structure](CAS/GIF/688810-12-0.gif) |
| | Boronic acid, [4-(difluoromethoxy)phenyl]- (9CI) Chemical Properties |
| Boiling point | 299.8±50.0 °C(Predicted) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | 8.41±0.16(Predicted) | | form | lumpy powder | | color | White | | InChI | InChI=1S/C7H7BF2O3/c9-7(10)13-6-3-1-5(2-4-6)8(11)12/h1-4,7,11-12H | | InChIKey | MFZNJRNTHPKCFY-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(OC(F)F)C=C1)(O)O |
| | Boronic acid, [4-(difluoromethoxy)phenyl]- (9CI) Usage And Synthesis |
| Uses | 4-(Difluoromethoxy)phenylboronic acid |
| | Boronic acid, [4-(difluoromethoxy)phenyl]- (9CI) Preparation Products And Raw materials |
|