|
|
| | 2,4-DICHLORO-6-MORPHOLINO-1,3,5-TRIAZINE Basic information |
| Product Name: | 2,4-DICHLORO-6-MORPHOLINO-1,3,5-TRIAZINE | | Synonyms: | AKOS 90019;2,4-DICHLORO-6-MORPHOLINO-1,3,5-TRIAZINE;2,4-Dichloro-6-Morpholino-1,3,;2,6-Dichloro-4-morpholino-1,3,5-triazine;2,4-Chloro-6-(morpholin-4-yl)-1,3,5-triazine;EOS-60795;4-(4,6-dichloro-1,3,5-triazin-2-yl)morph;1,3,5-Triazine, 2,4-dichloro-6-(4-morpholinyl)- | | CAS: | 6601-22-5 | | MF: | C7H8Cl2N4O | | MW: | 235.07 | | EINECS: | 229-544-9 | | Product Categories: | | | Mol File: | 6601-22-5.mol |  |
| | 2,4-DICHLORO-6-MORPHOLINO-1,3,5-TRIAZINE Chemical Properties |
| Melting point | 137 °C | | Boiling point | 441.9±55.0 °C(Predicted) | | density | 1.503±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder to crystal | | pka | 1.01±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C7H8Cl2N4O/c8-5-10-6(9)12-7(11-5)13-1-3-14-4-2-13/h1-4H2 | | InChIKey | UQAMDAUJTXFNAD-UHFFFAOYSA-N | | SMILES | N1=C(N2CCOCC2)N=C(Cl)N=C1Cl |
| | 2,4-DICHLORO-6-MORPHOLINO-1,3,5-TRIAZINE Usage And Synthesis |
| Synthesis | The general procedure for the synthesis of 2,4-dichloro-6-morpholino-1,3,5-triazine from morpholine was as follows: to a solution of cyanuric acid (230.5 g, 1,250 mmol) in acetone (2.25 L) was slowly added dropwise at 5°C morpholine (98.0 g, 1,125 mmol) and triethylamine (113.0 g, 1,125 mmol) in acetone (2.25 L) solution. After completion of the reaction, the resulting mixture was poured into water to precipitate the product. The white precipitate was collected by filtration and washed with methanol to give final white crystals 2,4-dichloro-6-morpholino-1,3,5-triazine (231.9 g, 986.9 mmol) in 88% yield. The mass spectrum (MS) of the product showed m/z: 234 (M+) and the nuclear magnetic resonance hydrogen spectrum (1H-NMR, CDCl3) showed δ: 3.75 (4H, triple peak, J=4Hz), 3.87 (4H, triple peak, J=4Hz). | | References | [1] Patent: US2007/244110, 2007, A1. Location in patent: Page/Page column 4 |
| | 2,4-DICHLORO-6-MORPHOLINO-1,3,5-TRIAZINE Preparation Products And Raw materials |
|