|
|
| | 2-BROMO-5-CYANO-4-PICOLINE Basic information | | Application |
| Product Name: | 2-BROMO-5-CYANO-4-PICOLINE | | Synonyms: | 2-BROMO-5-CYANO-4-PICOLINE;6-Bromo-4-methyl-3-pyridinecarbonitrile;6-bromo-4-methylpyridine-3-carbonitrile;3-Pyridinecarbonitrile, 6-bromo-4-methyl-;6-broMo-4-Methylnicotinonitrile | | CAS: | 1003711-35-0 | | MF: | C7H5BrN2 | | MW: | 197.03 | | EINECS: | 125-856-9 | | Product Categories: | | | Mol File: | Mol File |  |
| | 2-BROMO-5-CYANO-4-PICOLINE Chemical Properties |
| Boiling point | 288℃ | | density | 1.61 | | Fp | 128℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -2.00±0.18(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H5BrN2/c1-5-2-7(8)10-4-6(5)3-9/h2,4H,1H3 | | InChIKey | DHUDYHHQMIRPHS-UHFFFAOYSA-N | | SMILES | C1=NC(Br)=CC(C)=C1C#N |
| | 2-BROMO-5-CYANO-4-PICOLINE Usage And Synthesis |
| Application | 6-Bromo-4-methylpyridin-3-carboxynitrile can be used to prepare substituted nitrogen-containing heterocyclic compounds that can be used as inhibitors of ROMK channel activity. Multiple pieces of evidence indicate that inhibition of ROMK channel activity leads to urinary sodium excretion, diuresis, and a decrease in blood pressure. Therefore, ROMK inhibition may provide a novel mechanism for blood pressure regulation and diuresis in patients with hypertension, congestive heart failure, or any other edematous conditions. |
| | 2-BROMO-5-CYANO-4-PICOLINE Preparation Products And Raw materials |
|