|
|
| | (S)-2-BENZYL-AZIRIDINE
Basic information |
| Product Name: | (S)-2-BENZYL-AZIRIDINE
| | Synonyms: | Aziridine,2-(phenylMethyl)-, (2S)-;(S)-2-BENZYL-AZIRIDINEZENE-1,3-DIAMINE;(S)-2-BENZYL-AZIRIDINE ISO 9001：2015 REACH;(2S)-2-Benzylaziridine | | CAS: | 73058-30-7 | | MF: | C9H11N | | MW: | 133.19 | | EINECS: | | | Product Categories: | | | Mol File: | 73058-30-7.mol |  |
| | (S)-2-BENZYL-AZIRIDINE
Chemical Properties |
| Boiling point | 80-85 °C(Press: 0.5 Torr) | | density | 1.044±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C | | solubility | Chloroform (Slightly), Ethanol (Slightly), Methanol (Slightly) | | form | Oil | | pka | 8.14±0.40(Predicted) | | color | Colourless to Pale Beige | | InChI | InChI=1S/C9H11N/c1-2-4-8(5-3-1)6-9-7-10-9/h1-5,9-10H,6-7H2/t9-/m0/s1 | | InChIKey | LKQAJXTWYDNYHK-VIFPVBQESA-N | | SMILES | N1C[C@@H]1CC1=CC=CC=C1 |
| | (S)-2-BENZYL-AZIRIDINE
Usage And Synthesis |
| Chemical Properties | light yellow liquid | | Uses | (S)-2-Benzylaziridine is a reagent for the synthesis of renin inhibitors, taurine andcannabinoid type 2 (CB2) receptor agonists. |
| | (S)-2-BENZYL-AZIRIDINE
Preparation Products And Raw materials |
|