4-(2-AMINO-ETHYL)-2-METHOXY-PHENOL
manufacturers
- 3-Methoxytyramine
-
- $200.00
-
2026-07-09
- CAS:554-52-9
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
|
| | 4-(2-AMINO-ETHYL)-2-METHOXY-PHENOL
Basic information |
| Product Name: | 4-(2-AMINO-ETHYL)-2-METHOXY-PHENOL
| | Synonyms: | 4-(2-Aminoethyl)-2-methoxyphenol ,98%;4-(2-AMino-ethyl)-2-Methoxy-phenol.HCl;4-HYDROXY-3-METHOXYPHENETHYLAMINE;3-Methyldopamine;4-(2-Aminoeth-yl)guaiacol;Homovanily amine;3-Methoxydopamine;Dopamine Impurity 1 (3-Methoxytyramine) | | CAS: | 554-52-9 | | MF: | C9H13NO2 | | MW: | 167.21 | | EINECS: | 205-525-8 | | Product Categories: | 1 | | Mol File: | 554-52-9.mol |  |
| | 4-(2-AMINO-ETHYL)-2-METHOXY-PHENOL
Chemical Properties |
| Melting point | 89 °C | | Boiling point | 304.5±27.0 °C(Predicted) | | density | 1.126±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Acetonitrile (Slightly, Heated), Methanol (Slightly, Heated), Water (Slightly) | | form | Solid | | pka | 9.57±0.31(Predicted) | | color | Pale Brown to Light Brown | | Stability: | Hygroscopic | | InChI | InChI=1S/C9H13NO2/c1-12-9-6-7(4-5-10)2-3-8(9)11/h2-3,6,11H,4-5,10H2,1H3 | | InChIKey | DIVQKHQLANKJQO-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(CCN)C=C1OC | | NIST Chemistry Reference | 3-Methoxy-4-hydroxyphenylethyl amine(554-52-9) |
| | 4-(2-AMINO-ETHYL)-2-METHOXY-PHENOL
Usage And Synthesis |
| Chemical Properties | Grey crystalline powder | | Uses | 4-(2-Aminoethyl)-2-methoxyphenol is a respective metabolite to dopamine and is being biologically study in Parkinson’s disease, and Wilms’ tumors. | | Definition | ChEBI: 3-methoxytyramine is a monomethoxybenzene that is dopamine in which the hydroxy group at position 3 is replaced by a methoxy group. It is a metabolite of the neurotransmitter dopamine and considered a potential biomarker of pheochromocytomas and paragangliomas. It has a role as a human blood serum metabolite, a human urinary metabolite and a biomarker. It is a member of phenols, a primary amino compound, a monomethoxybenzene and a phenylethylamine. It is functionally related to a dopamine. It is a conjugate base of a 3-methoxytyraminium. | | in vivo | The extracellular dopamine (DA) metabolite 3-methoxytyramine (3-MT) induces significant behavioral activation in dopamine-deficient DAT-KO (DDD) mice. 3-Methoxytyramine induces behavioral activation and intracellular signaling in the striatum of DA deficient mice[1]. | | IC 50 | Human Endogenous Metabolite |
| | 4-(2-AMINO-ETHYL)-2-METHOXY-PHENOL
Preparation Products And Raw materials |
|