|
|
| | 11-Maleimidoundecanoic acid Basic information |
| | 11-Maleimidoundecanoic acid Chemical Properties |
| Melting point | 89-90°C | | Boiling point | 452.8±18.0 °C(Predicted) | | density | 1.139±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Soluble in methanol, and chloroform. | | pka | 4.78±0.10(Predicted) | | form | Powder | | color | White to off-white | | InChI | 1S/C15H23NO4/c17-13-10-11-14(18)16(13)12-8-6-4-2-1-3-5-7-9-15(19)20/h10-11H,1-9,12H2,(H,19,20) | | InChIKey | UVZTZBRGZXIBLZ-UHFFFAOYSA-N | | SMILES | OC(=O)CCCCCCCCCCN1C(=O)C=CC1=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 11-Maleimidoundecanoic acid Usage And Synthesis |
| Uses | The maleimide functional group can be used to conjugate a variety of biomolecules such as enzymes and DNA to the polymer chain. | | Uses | A sulfhydryl reactive heterobifunctional crosslinking reagent.
Spacer Arm: 15.7 Angstroms | | General Description | Intermediate for ester and amide linked maleimide monomers, can be used to generate liquid crystal copolymers | | IC 50 | Alkyl-Chain |
| | 11-Maleimidoundecanoic acid Preparation Products And Raw materials |
|