4-nitro-1H-indole-3-carbaldehyde manufacturers
|
| | 4-nitro-1H-indole-3-carbaldehyde Basic information |
| | 4-nitro-1H-indole-3-carbaldehyde Chemical Properties |
| Melting point | 189-193 °C | | Boiling point | 441.5±25.0 °C(Predicted) | | density | 1.516±0.06 g/cm3(Predicted) | | pka | 13.27±0.30(Predicted) | | form | Solid | | color | Yellow | | InChI | InChI=1S/C9H6N2O3/c12-5-6-4-10-7-2-1-3-8(9(6)7)11(13)14/h1-5,10H | | InChIKey | CGXVTWQTGQAMMX-UHFFFAOYSA-N | | SMILES | N1C2=C(C([N+]([O-])=O)=CC=C2)C(C=O)=C1 | | CAS DataBase Reference | 10553-11-4 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-nitro-1H-indole-3-carbaldehyde Usage And Synthesis |
| Uses | • ;reactant in synthesis of tryptophan dioxygenase inhibitors as potential anticancer immunomodulators1• ;reactant in synthesis of structural analogs of thaxtomin2• ;reactant in preparation of chromophores related to gold fluorescent protein3• ;reactant in preparation of brassinin and gramine derivatives4 | | Uses | - reactant in synthesis of tryptophan dioxygenase inhibitors as potential anticancer immunomodulators
- reactant in synthesis of structural analogs of thaxtomin
- reactant in preparation of chromophores related to gold fluorescent protein
- reactant in preparation of brassinin and gramine derivatives
|
| | 4-nitro-1H-indole-3-carbaldehyde Preparation Products And Raw materials |
|