|
|
| | NSC25824 Basic information |
| Product Name: | NSC25824 | | Synonyms: | NSC25824;(Tosylamino)acetic acid ethyl ester;2-(Tosylamino)acetic acid ethyl ester;2-[(4-Methylphenyl)sulfonylamino]acetic acid ethyl ester;Glycine, N-[(4-Methylphenyl)sulfonyl]-, ethyl ester;N-[(4-Methylphenyl)sulfonyl]-, ethyl ester;ETHYL N-P-TOLYLSULFONYL-GLYCINATE;ethyl N-tosylglycinate | | CAS: | 5465-67-8 | | MF: | C11H15NO4S | | MW: | 257.31 | | EINECS: | | | Product Categories: | | | Mol File: | 5465-67-8.mol |  |
| | NSC25824 Chemical Properties |
| Melting point | 64-66 °C | | Boiling point | 384.7±52.0 °C(Predicted) | | density | 1.229±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 9.25±0.50(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H15NO4S/c1-3-16-11(13)8-12-17(14,15)10-6-4-9(2)5-7-10/h4-7,12H,3,8H2,1-2H3 | | InChIKey | WZLAJHNLDCWPGH-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)CNS(C1=CC=C(C)C=C1)(=O)=O |
| | NSC25824 Usage And Synthesis |
| | NSC25824 Preparation Products And Raw materials |
|