| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
orders@qcsrm.com |
| Products Intro: |
Product Name:4-amino-3,5-dichlorophenol CAS:26271-75-0 Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
|
| | 3,5-dichloro-1,4-aminophenol Basic information | | Uses |
| | 3,5-dichloro-1,4-aminophenol Chemical Properties |
| InChI | InChI=1S/C6H5Cl2NO/c7-4-1-3(10)2-5(8)6(4)9/h1-2,10H,9H2 | | InChIKey | PEJIOEOCSJLAHT-UHFFFAOYSA-N | | SMILES | C1(O)=CC(Cl)=C(N)C(Cl)=C1 |
| | 3,5-dichloro-1,4-aminophenol Usage And Synthesis |
| Uses | 4-Amino-3,5-dichlorophenol is a useful research chemical compound. |
| | 3,5-dichloro-1,4-aminophenol Preparation Products And Raw materials |
|