|
|
| | Etidronic acid monohydrate Basic information |
| Product Name: | Etidronic acid monohydrate | | Synonyms: | EtidronicAcidMonohydrate;Etidronic acid Monohydrate >=95.0% (T);11-Hydroxyethane-1,1-diphosphonic acid;(1-hydroxy-1-phosphonoethyl)phosphonicacid,hydrate;Etidronic acid 1-hydrate;Etidronic Acid Monohydrate (1268604);(1-Hydroxyethane-1,1-diyl)bis(phosphonic acid) hydrate;Etidronic acid,60% in water (monohydrate) | | CAS: | 25211-86-3 | | MF: | C2H10O8P2 | | MW: | 224.04 | | EINECS: | 629-385-9 | | Product Categories: | | | Mol File: | 25211-86-3.mol |  |
| | Etidronic acid monohydrate Chemical Properties |
| storage temp. | 2-8°C | | InChI | 1S/C2H8O7P2.H2O/c1-2(3,10(4,5)6)11(7,8)9;/h3H,1H3,(H2,4,5,6)(H2,7,8,9);1H2 | | InChIKey | KKNZXUHBWLPUFN-UHFFFAOYSA-N | | SMILES | O.CC(O)(P(O)(O)=O)P(O)(O)=O |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-37/38-41 | | Safety Statements | 26-39-36 | | RIDADR | UN 3082 9 / PGIII | | WGK Germany | 2 | | RTECS | SZ8562100 | | HS Code | 2931399000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2
Eye Dam. 1 |
| | Etidronic acid monohydrate Usage And Synthesis |
| Uses | A powerful complexing agent. | | Uses | Etidronic acid monohydrate also known as 1-hydroxyethylidenediphosphonic acid (HEDP) is an organophosphonic acid that can be used to surface functionalize NaY molecular sieves. HEDP/NaY can be used as a catalyst for n-butyl acetate production via esterification.
It can be also employed as a chelating agent in the synthesis of metal-ligand complexes. |
| | Etidronic acid monohydrate Preparation Products And Raw materials |
|