|
|
| | 2,6-DIMETHOXY-4-METHYLQUINOLINE Basic information |
| Product Name: | 2,6-DIMETHOXY-4-METHYLQUINOLINE | | Synonyms: | 2,6-DIMETHOXY-4-METHYLQUINOLINE;2-Chloro-6-methoxylepidine;Quinoline, 2-chloro-6-Methoxy-4-Methyl-;2-Chloro-6-methoxy-4-methylquinoline - [C24654] | | CAS: | 6340-55-2 | | MF: | C11H10ClNO | | MW: | 207.66 | | EINECS: | | | Product Categories: | | | Mol File: | 6340-55-2.mol |  |
| | 2,6-DIMETHOXY-4-METHYLQUINOLINE Chemical Properties |
| storage temp. | Storage temp. 2-8°C | | solubility | soluble in Chloroform, Dichloromethane | | form | powder | | color | Light pink | | InChI | 1S/C11H10ClNO/c1-7-5-11(12)13-10-4-3-8(14-2)6-9(7)10/h3-6H,1-2H3 | | InChIKey | VXGIQWGIRMJJDC-UHFFFAOYSA-N | | SMILES | ClC1=NC2=C(C(C)=C1)C=C(OC)C=C2 |
| WGK Germany | WGK 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1 |
| | 2,6-DIMETHOXY-4-METHYLQUINOLINE Usage And Synthesis |
| Uses | 2-Chloro-6-methoxy-4-methylquinoline is an intermediate in the synthesis of Tafenoquine-d3 Succinate which is the labelled analog of Tatenoquine (T004760), a new 8-aminoquinoline with an improved therapeutic index and safety profile as compared to primaquine (P733500).Tafenoquine has the potential to become a widely used drug in the prevention and treatment of malaria infection and could replace some currently used drugs as resistant strains of Plasmodium species increase. |
| | 2,6-DIMETHOXY-4-METHYLQUINOLINE Preparation Products And Raw materials |
|