|
|
| | 2-BROMO-4-METHOXY-6-NITROPHENOL Basic information |
| | 2-BROMO-4-METHOXY-6-NITROPHENOL Chemical Properties |
| Melting point | 116-120 °C (lit.) | | Boiling point | 288.0±35.0 °C(Predicted) | | density | 1.773±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | solubility | soluble in Acetone | | form | powder to crystal | | pka | 5.57±0.38(Predicted) | | color | Light yellow to Brown | | λmax | 394nm(MeOH)(lit.) | | InChI | 1S/C7H6BrNO4/c1-13-4-2-5(8)7(10)6(3-4)9(11)12/h2-3,10H,1H3 | | InChIKey | GAVVLRJHVWIDPK-UHFFFAOYSA-N | | SMILES | COc1cc(Br)c(O)c(c1)[N+]([O-])=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2909500090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-BROMO-4-METHOXY-6-NITROPHENOL Usage And Synthesis |
| | 2-BROMO-4-METHOXY-6-NITROPHENOL Preparation Products And Raw materials |
|