| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:D-Ribose-2-13C CAS:83379-40-2 Package:100Mg,10Mg
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:D-Ribose-2-13C CAS:83379-40-2 Purity:NULL Package:100mg;10mg Remarks:NULL
|
| Company Name: |
Reer Technology (Shanghai) Co., LTD
|
| Tel: |
021-64400900 15800436310 |
| Email: |
bessey@reertech.com |
| Products Intro: |
Product Name:D-RIBOSE(2-13C, 99%) CAS:83379-40-2 Purity:98% Package:G Remarks:CLM-1069-PK
|
|
| | D-RIBOSE-2-13C Basic information |
| | D-RIBOSE-2-13C Chemical Properties |
| Melting point | 88-92 °C (dec.)(lit.) | | form | solid | | Optical Rotation | [α]20/D -20, c = 4 in H2O | | InChI | 1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3-,4-,5/m1/s1/i4+1 | | InChIKey | HMFHBZSHGGEWLO-VTUWIFRDSA-N | | SMILES | OC[C@H]1OC(O)[13C@H](O)[C@@H]1O | | CAS Number Unlabeled | 50-69-1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | D-RIBOSE-2-13C Usage And Synthesis |
| Uses | Labeled D-Ribose, which is produced by microorganism fermentation of glucose in a fermentation culture medium without adding calcium carbonate. |
| | D-RIBOSE-2-13C Preparation Products And Raw materials |
|