|
|
| | 2,6-Dimethyl-3-nitropyridine Basic information |
| Product Name: | 2,6-Dimethyl-3-nitropyridine | | Synonyms: | 2,6-DIMETHYL-3-NITROPYRIDINE;3-NITRO-2,6-DIMETHYLPYRIDINE;3-Nitro-2,6-lutidine,99%;Pyridine,2,6-diMethyl-3-nitro-;2,6-DiMethyl-3-nitroypyridine;2,6-Dimethyl-3-nitropyridine >3-Bromo-3-Nitropyridine;2,6-Dimethyl-3-nitropyridine ISO 9001:2015 REACH | | CAS: | 15513-52-7 | | MF: | C7H8N2O2 | | MW: | 152.15 | | EINECS: | 239-543-5 | | Product Categories: | Heterocycle-Pyridine series;Building Blocks;Pyridine;C6 to C7;Chemical Synthesis;Heterocyclic Building Blocks;C7 and C8;Heterocyclic Building Blocks;Pyridines | | Mol File: | 15513-52-7.mol |  |
| | 2,6-Dimethyl-3-nitropyridine Chemical Properties |
| Melting point | 26-31 °C (lit.) | | Boiling point | 105°C/10mmHg(lit.) | | density | 1.45 | | Fp | 100 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | Powder | | pka | 2+-.0.10(Predicted) | | color | Off-white to tan | | InChI | 1S/C7H8N2O2/c1-5-3-4-7(9(10)11)6(2)8-5/h3-4H,1-2H3 | | InChIKey | AETHUDGJSSKZKT-UHFFFAOYSA-N | | SMILES | Cc1ccc(c(C)n1)[N+]([O-])=O | | CAS DataBase Reference | 15513-52-7(CAS DataBase Reference) |
| Hazard Codes | F,Xi,Xn | | Risk Statements | 11-36/37/38 | | Safety Statements | 16-26-36 | | RIDADR | UN 1325 4.1/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 4.1 | | PackingGroup | III | | HS Code | 29333999 | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Eye Irrit. 2 Flam. Sol. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,6-Dimethyl-3-nitropyridine Usage And Synthesis |
| Chemical Properties | Off-white to tan powder | | Uses | 3-Nitro-2,6-lutidine may be used in the preparation of 3-methoxy-2,7-dimethyl-2H-1,4-diazepine1 and 3-amino-2,6-lutidine. | | General Description | 3-Nitro-2,6-lutidine, a nitropyridine derivative, is also known as 2,6-dimethyl-3-nitropyridine. It can be prepared from 2,6-lutidine via nitration. |
| | 2,6-Dimethyl-3-nitropyridine Preparation Products And Raw materials |
|