|
|
| | 5H-Pyrido[3,2-b]indole Basic information |
| Product Name: | 5H-Pyrido[3,2-b]indole | | Synonyms: | 5H-Pyrido[3,2-b]indole;delta-Carboline;5H-Pyrido[3,2-b]indole;5H-Pyrido[3,2-b]indole>δ-Carboline | | CAS: | 245-08-9 | | MF: | C11H8N2 | | MW: | 168.19 | | EINECS: | | | Product Categories: | | | Mol File: | 245-08-9.mol | ![5H-Pyrido[3,2-b]indole Structure](CAS/GIF/245-08-9.gif) |
| | 5H-Pyrido[3,2-b]indole Chemical Properties |
| Melting point | 225℃ | | Boiling point | 372.9±15.0 °C(Predicted) | | density | 1.301±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 15.20±0.30(Predicted) | | form | powder | | color | White to Light yellow to Light orange | | InChI | 1S/C11H8N2/c1-2-5-9-8(4-1)11-10(13-9)6-3-7-12-11/h1-7,13H | | InChIKey | NSBVOLBUJPCPFH-UHFFFAOYSA-N | | SMILES | C1(C=CC=C2)=C2C(N=CC=C3)=C3N1 |
| RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | HS Code | 2933.99.9701 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 5H-Pyrido[3,2-b]indole Usage And Synthesis |
| Uses | Novel aromatic amine compound for organic electroluminescent device, illuminating device and display. |
| | 5H-Pyrido[3,2-b]indole Preparation Products And Raw materials |
|