- Boc-Dap(Fmoc)-OH
-
-
2026-06-05
- CAS:122235-70-5
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | BOC-DAP(FMOC)-OH Basic information |
| Product Name: | BOC-DAP(FMOC)-OH | | Synonyms: | Boc-3-(Fmoc-amino)-L-alanine, Nα-Boc-Nβ-Fmoc-L-2,3-diaminopropionic acid;NALPHA-tert-Butoxycarbonyl-NB-9-fluorenylmethoxycarbonyl-L-2,3-diaminopropi;N-.ALPHA.-BOC-N-.BETA.-FMOC-L-2,3-DIAMIOPROPIONIC ACID;N-Boc-N-Fmoc-(S)-2,3-diaminopropionic acid;N-α-Boc-N-β-Fmoc-L-2,3-diamiopropionic acid;(S)-2,3-Diaminopropanoic acid, N2-BOC, N3-FMOC protected;3-[(9H-Fluoren-9-ylmethoxycarbonyl)amino]-L-alanine, N-BOC protected;Boc-Dapa(FMoc)-OH | | CAS: | 122235-70-5 | | MF: | C23H26N2O6 | | MW: | 426.46 | | EINECS: | 1533716-785-6 | | Product Categories: | Unusual amino acids;Amino Acids;amino acid | | Mol File: | 122235-70-5.mol |  |
| | BOC-DAP(FMOC)-OH Chemical Properties |
| Melting point | 81-89° (dec.) | | Boiling point | 652.5±55.0 °C(Predicted) | | density | 1.263±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in 2ml dimethyl formamide 0.3gram. | | form | solid | | pka | 3+-.0.10(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | Consistent with structure | | BRN | 4771385 | | Major Application | peptide synthesis | | InChIKey | MVWPBNQGEGBGRF-IBGZPJMESA-N | | SMILES | C(O)(=O)[C@H](CNC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)NC(OC(C)(C)C)=O |
| Hazard Codes | Xi | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | BOC-DAP(FMOC)-OH Usage And Synthesis |
| Chemical Properties | Solid | | Uses | It has been used in the synthesis of target chelator, the tris-catechol compound 2. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-DAP(FMOC)-OH Preparation Products And Raw materials |
|