|
|
| | (S)-(+)-2,2-Dimethylcyclopropanecarboxamide Basic information |
| Product Name: | (S)-(+)-2,2-Dimethylcyclopropanecarboxamide | | Synonyms: | (S)-2,2-DIMETHYL-CYCLOPROPANECARBOXYLIC ACID AMIDE;S-(+)-2,2-DIMETHYLCYCLOPROPANE-1-CARBOXAMIDE;(S) 2,2-DIMETHYL CYCLOPROPANE CARBOXAMIDE;(S)-(+)-2,2-DIMETHYLCYCLOPROPANECARBOXAMIDE;CYCLOPROPANECARBOXAMIDE, 2,2-DIMETHYL-, (1S)-;(S)-(+)-DMCPA;(S)(R)-(+)-2,2-Dimethyl Cycolpropane Carboxamide;(S)-(R)-(+)-2,2-DIMETHYL CYCLOPROPANE CARBOXAMIDE | | CAS: | 75885-58-4 | | MF: | C6H11NO | | MW: | 113.16 | | EINECS: | 278-334-3 | | Product Categories: | Simple 3-Membered Ring Compounds;Synthetic Organic Chemistry;Amides (Chiral);Chiral Compound;Chiral Building Blocks;Organic Building Blocks;AMIDE;Amides;Chiral Compounds;chiral;API intermediates;API;Chiral Building Blocks;Cyclopropanes | | Mol File: | 75885-58-4.mol |  |
| | (S)-(+)-2,2-Dimethylcyclopropanecarboxamide Chemical Properties |
| Melting point | 135-137 °C (lit.) | | alpha | 82 º (c=1, MeOH) | | Boiling point | 203 - 204 | | density | 1g/cm | | refractive index | 83 ° (C=1, MeOH) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in methanol | | form | Crystalline Powder | | pka | 16.61±0.40(Predicted) | | color | White to Off-white | | Optical Rotation | [α]20/D +82°, c = 1 in methanol | | InChI | InChI=1S/C6H11NO/c1-6(2)3-4(6)5(7)8/h4H,3H2,1-2H3,(H2,7,8)/t4-/m1/s1 | | InChIKey | YBZQRYWKYBZZNT-SCSAIBSYSA-N | | SMILES | [C@H]1(C(N)=O)CC1(C)C | | CAS DataBase Reference | 75885-58-4(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (S)-(+)-2,2-Dimethylcyclopropanecarboxamide Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Employed in the preparation of (Z)-2-(acylamino)-3-substituted propenoic acids as inhibitors of the mammalian β-lactamase renal dipeptidase. |
| | (S)-(+)-2,2-Dimethylcyclopropanecarboxamide Preparation Products And Raw materials |
| Raw materials | 2,5-Pyrrolidinedione, 1-[[(2,2-dimethylcyclopropyl)carbonyl]oxy]-, (S)- (9CI)-->Cyclopropanecarboxylic acid, 2,2-dimethyl-, ethyl ester, (S)--->(S)-(+)-2,2-DIMETHYLCYCLOPROPANE CARBOXYLIC ACID-->2,2-DIMETHYL CYCLOPROPYL CARBOXYLIC ACID | | Preparation Products | Cilastatin-->Ethyl 7-chloro-2-oxoheptanoate-->(R)-2,2-DIMETHYLCYCLOPROPANECARBOXYLIC ACID |
|