|
|
| | 2-AMINO-4-METHOXY-BENZOIC ACID Basic information |
| Product Name: | 2-AMINO-4-METHOXY-BENZOIC ACID | | Synonyms: | 2-AMINO-4-METHOXY-BENZOIC ACID;4-METHOXY-2-AMINO-BENZOIC ACID;2-AMINO-4-METHOXYBENZOIC ACID ---OFF-WHITE POWDER, 99%---;2-amine-4-methoxybenzoic acid;2-azanyl-4-methoxy-benzoic acid;4-Methoxyanthranilic acid, 2-Carboxy-5-methoxyaniline, 3-Amino-4-carboxyanisole;4-METHOXY-2-AMINO-BENZOIC ACID(or 4-METHOXYANTHRANILIC ACID);4-Methoxyanthranilic Acid
m-Anisidine-6-carboxylic Acid
2-Amino-p-anisic Acid | | CAS: | 4294-95-5 | | MF: | C8H9NO3 | | MW: | 167.16 | | EINECS: | 618-347-7 | | Product Categories: | pharmacetical | | Mol File: | 4294-95-5.mol |  |
| | 2-AMINO-4-METHOXY-BENZOIC ACID Chemical Properties |
| Melting point | 175-180 °C | | Boiling point | 339.8±27.0 °C(Predicted) | | density | 1.303±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 5.21±0.10(Predicted) | | color | White to Light yellow to Light orange | | Major Application | peptide synthesis | | InChI | InChI=1S/C8H9NO3/c1-12-5-2-3-6(8(10)11)7(9)4-5/h2-4H,9H2,1H3,(H,10,11) | | InChIKey | HHNWXQCVWVVVQZ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(OC)C=C1N | | CAS DataBase Reference | 4294-95-5(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39-37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29225090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-AMINO-4-METHOXY-BENZOIC ACID Usage And Synthesis |
| Chemical Properties | Yellow powder | | Uses | 2-Amino-4-methoxybenzoic Acid, is an organic building block used in the synthesis of various chemical compounds. | | Synthesis | The general procedure for the synthesis of 2-amino-4-methoxybenzoic acid from 4-methoxy-2-nitrobenzoic acid is as follows:
Intermediate 113: Synthesis of 2-amino-4-methoxybenzoic acid
4-Methoxy-2-nitrobenzoic acid (3 g, 16.4 mmol) was dissolved in methanol (80 mL) and 10% palladium carbon catalyst (300 mg) was added. The hydrogenation reaction was carried out at room temperature and atmospheric pressure for 18 hours. Upon completion of the reaction, the reaction mixture was filtered through diatomaceous earth to remove the catalyst and the filtrate was concentrated to dryness under reduced pressure to give 2.50 g (100% yield) of 2-amino-4-methoxybenzoic acid as a colorless solid.
1H NMR (DMSO-d6) δ: 3.70 (s, 3H); 6.09 (dd, 1H); 6.23 (d, 1H); 7.59 (d, 1H). | | References | [1] Patent: WO2006/134378, 2006, A1. Location in patent: Page/Page column 112
[2] Patent: WO2010/123975, 2010, A1. Location in patent: Page/Page column 101-102
[3] Patent: US2013/281398, 2013, A1. Location in patent: Paragraph 0493; 0494
[4] Patent: US5599814, 1997, A
[5] Patent: WO2007/71963, 2007, A2. Location in patent: Page/Page column 52 |
| | 2-AMINO-4-METHOXY-BENZOIC ACID Preparation Products And Raw materials |
|