|
|
| | 2-Amino-1-bromonaphthalene Basic information | | Uses |
| Product Name: | 2-Amino-1-bromonaphthalene | | Synonyms: | 2-AMINO-1-BROMONAPHTHALENE;1-bromo-2-aminonaphthalene;2-Naphthalenamine, 1-bromo-;2-amino-1-bromonaphthalin;1-bromo-naphthalen-2-ylamine;2-amine-1-bromonaphthalen;1-Bromo-2-naphthylamine;1-Bromo-2-Naphthalenamine | | CAS: | 20191-75-7 | | MF: | C10H8BrN | | MW: | 222.08 | | EINECS: | 202-080-4 | | Product Categories: | 20191-75-7 | | Mol File: | 20191-75-7.mol |  |
| | 2-Amino-1-bromonaphthalene Chemical Properties |
| Melting point | 63-64 °C(Solv: ligroine (8032-32-4)) | | Boiling point | 345.5±15.0 °C(Predicted) | | density | 1.563±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 1.51±0.10(Predicted) | | Appearance | Pale purple to purple Solid | | InChI | InChI=1S/C10H8BrN/c11-10-8-4-2-1-3-7(8)5-6-9(10)12/h1-6H,12H2 | | InChIKey | WENXBAFANCRIGK-UHFFFAOYSA-N | | SMILES | C1(Br)=C2C(C=CC=C2)=CC=C1N |
| | 2-Amino-1-bromonaphthalene Usage And Synthesis |
| Uses | 2-Amino-1-bromonaphthalene is used in organic synthesis and can be applied in laboratory research and development processes as well as in chemical and pharmaceutical synthesis. | | Chemical Properties |
White to Light yellow to Light red powder to crystal
| | Synthesis | The crude naphthalen-2-amine HCl salt (790 mg, 5.5 mmol) and TsOH (170 mg, 1.1 mmol) in THF (50 mL) cooled to 0 0C were treated with NBS (982 mg, 5.5 mmol) in THF (30 mL), and the solution was allowed to warm to 23 0C. After stirring for 5 hours, the reaction mixture was washed with saturated aqueous NaHCO3 (30 mL x 2). The organic layer was dried over anhydrous sodium sulfate and was concentrated to afford 2-Amino-1-bromonaphthalene.
 |
| | 2-Amino-1-bromonaphthalene Preparation Products And Raw materials |
|